Asprellic acid A
Internal ID | 8d958bf7-5e18-41c4-8ebc-e70762b0e022 |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Triterpenoids |
IUPAC Name | (4aS,6aR,6aR,6bR,8aR,10S,12aR,14bS)-10-[(E)-3-(4-hydroxyphenyl)prop-2-enoyl]oxy-6a-[[(E)-3-(4-hydroxyphenyl)prop-2-enoyl]oxymethyl]-2,2,6b,9,9,12a-hexamethyl-1,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydropicene-4a-carboxylic acid |
SMILES (Canonical) | CC1(CCC2(CCC3(C(=CCC4C3(CCC5C4(CCC(C5(C)C)OC(=O)C=CC6=CC=C(C=C6)O)C)C)C2C1)COC(=O)C=CC7=CC=C(C=C7)O)C(=O)O)C |
SMILES (Isomeric) | C[C@]12CC[C@@H](C([C@@H]1CC[C@@]3([C@@H]2CC=C4[C@]3(CC[C@@]5([C@H]4CC(CC5)(C)C)C(=O)O)COC(=O)/C=C/C6=CC=C(C=C6)O)C)(C)C)OC(=O)/C=C/C7=CC=C(C=C7)O |
InChI | InChI=1S/C48H60O8/c1-43(2)25-26-47(42(53)54)27-28-48(30-55-40(51)19-11-31-7-13-33(49)14-8-31)35(36(47)29-43)17-18-38-45(5)23-22-39(44(3,4)37(45)21-24-46(38,48)6)56-41(52)20-12-32-9-15-34(50)16-10-32/h7-17,19-20,36-39,49-50H,18,21-30H2,1-6H3,(H,53,54)/b19-11+,20-12+/t36-,37-,38+,39-,45-,46+,47-,48-/m0/s1 |
InChI Key | YBOIBOWMTWFCEG-MVYRAAOISA-N |
Popularity | 2 references in papers |
Molecular Formula | C48H60O8 |
Molecular Weight | 765.00 g/mol |
Exact Mass | 764.42881887 g/mol |
Topological Polar Surface Area (TPSA) | 130.00 Ų |
XlogP | 10.70 |
152509-92-7 |
3,27-di-O-trans-p-coumaroyl-3beta,27-dihydroxy-olean-12-en-28-oic acid |
Asprellic acid B |
(4aS,6aR,6aR,6bR,8aR,10S,12aR,14bS)-10-[(E)-3-(4-hydroxyphenyl)prop-2-enoyl]oxy-6a-[[(E)-3-(4-hydroxyphenyl)prop-2-enoyl]oxymethyl]-2,2,6b,9,9,12a-hexamethyl-1,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydropicene-4a-carboxylic acid |
3,27-Di-O-p-coumaroyloxyolean-12-en-28-oic acid |
CHEMBL4071791 |
CHEBI:65455 |
DTXSID701124820 |
LMPR0104010037 |
Q27133898 |
There are more than 10 synonyms. If you wish to see them all click here. |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL335 | P18031 | Protein-tyrosine phosphatase 1B | 96.53% | 95.17% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.50% | 91.11% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 95.79% | 97.09% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.62% | 96.09% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 95.01% | 86.33% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 93.52% | 95.56% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 92.83% | 94.45% |
CHEMBL206 | P03372 | Estrogen receptor alpha | 90.04% | 97.64% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 87.64% | 90.17% |
CHEMBL2581 | P07339 | Cathepsin D | 85.61% | 98.95% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 83.59% | 95.89% |
CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 83.52% | 91.71% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 82.91% | 94.75% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 81.34% | 100.00% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 81.11% | 89.00% |
CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 80.43% | 93.99% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 80.15% | 100.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Ilex asprella |
PubChem | 6444290 |
LOTUS | LTS0123430 |
wikiData | Q27133898 |