antimycin A1
Internal ID | d6dbb02f-025d-4001-a588-136dacdb43bc |
Taxonomy | Organic acids and derivatives > Carboxylic acids and derivatives > Amino acids, peptides, and analogues > N-acyl-alpha amino acids and derivatives |
IUPAC Name | [(2R,3S,6S,7R,8R)-3-[(3-formamido-2-hydroxybenzoyl)amino]-8-hexyl-2,6-dimethyl-4,9-dioxo-1,5-dioxonan-7-yl] 3-methylbutanoate |
SMILES (Canonical) | CCCCCCC1C(C(OC(=O)C(C(OC1=O)C)NC(=O)C2=C(C(=CC=C2)NC=O)O)C)OC(=O)CC(C)C |
SMILES (Isomeric) | CCCCCC[C@@H]1[C@H]([C@@H](OC(=O)[C@H]([C@H](OC1=O)C)NC(=O)C2=C(C(=CC=C2)NC=O)O)C)OC(=O)CC(C)C |
InChI | InChI=1S/C28H40N2O9/c1-6-7-8-9-11-20-25(39-22(32)14-16(2)3)18(5)38-28(36)23(17(4)37-27(20)35)30-26(34)19-12-10-13-21(24(19)33)29-15-31/h10,12-13,15-18,20,23,25,33H,6-9,11,14H2,1-5H3,(H,29,31)(H,30,34)/t17-,18+,20-,23+,25+/m1/s1 |
InChI Key | UIFFUZWRFRDZJC-SBOOETFBSA-N |
Popularity | 3,121 references in papers |
Molecular Formula | C28H40N2O9 |
Molecular Weight | 548.60 g/mol |
Exact Mass | 548.27338086 g/mol |
Topological Polar Surface Area (TPSA) | 157.00 Ų |
XlogP | 5.30 |
Atomic LogP (AlogP) | 3.48 |
H-Bond Acceptor | 9 |
H-Bond Donor | 3 |
Rotatable Bonds | 12 |
Antimycin A1b |
Antipiricullin |
Fintrol |
Virosin |
antimycin A1 |
1397-94-0 |
Antimycin-A |
Caswell No. 052B |
CCRIS 924 |
HSDB 6417 |
There are more than 10 synonyms. If you wish to see them all click here. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
Human Intestinal Absorption | + | 0.6257 | 62.57% |
Caco-2 | - | 0.8111 | 81.11% |
Blood Brain Barrier | - | 0.7750 | 77.50% |
Human oral bioavailability | - | 0.7429 | 74.29% |
Subcellular localzation | Mitochondria | 0.6311 | 63.11% |
OATP2B1 inhibitior | - | 0.7160 | 71.60% |
OATP1B1 inhibitior | - | 0.7738 | 77.38% |
OATP1B3 inhibitior | - | 0.5699 | 56.99% |
MATE1 inhibitior | - | 0.9400 | 94.00% |
OCT2 inhibitior | - | 0.9322 | 93.22% |
BSEP inhibitior | + | 0.7799 | 77.99% |
P-glycoprotein inhibitior | - | 0.8346 | 83.46% |
P-glycoprotein substrate | + | 0.7770 | 77.70% |
CYP3A4 substrate | + | 0.6485 | 64.85% |
CYP2C9 substrate | + | 0.8087 | 80.87% |
CYP2D6 substrate | - | 0.8717 | 87.17% |
CYP3A4 inhibition | + | 0.7960 | 79.60% |
CYP2C9 inhibition | - | 0.9071 | 90.71% |
CYP2C19 inhibition | - | 0.9025 | 90.25% |
CYP2D6 inhibition | - | 0.9231 | 92.31% |
CYP1A2 inhibition | - | 0.9045 | 90.45% |
CYP2C8 inhibition | + | 0.6343 | 63.43% |
CYP inhibitory promiscuity | - | 0.8682 | 86.82% |
UGT catelyzed | + | 0.7000 | 70.00% |
Carcinogenicity (binary) | - | 0.9700 | 97.00% |
Carcinogenicity (trinary) | Non-required | 0.7035 | 70.35% |
Eye corrosion | - | 0.9884 | 98.84% |
Eye irritation | - | 0.9529 | 95.29% |
Skin irritation | - | 0.8159 | 81.59% |
Skin corrosion | - | 0.9451 | 94.51% |
Ames mutagenesis | - | 0.6400 | 64.00% |
Human Ether-a-go-go-Related Gene inhibition | - | 0.5681 | 56.81% |
Micronuclear | + | 0.7900 | 79.00% |
Hepatotoxicity | + | 0.5875 | 58.75% |
skin sensitisation | - | 0.8317 | 83.17% |
Respiratory toxicity | + | 0.7222 | 72.22% |
Reproductive toxicity | + | 0.6530 | 65.30% |
Mitochondrial toxicity | + | 0.6125 | 61.25% |
Nephrotoxicity | + | 0.5814 | 58.14% |
Acute Oral Toxicity (c) | III | 0.7742 | 77.42% |
Estrogen receptor binding | + | 0.7809 | 78.09% |
Androgen receptor binding | + | 0.7612 | 76.12% |
Thyroid receptor binding | + | 0.5134 | 51.34% |
Glucocorticoid receptor binding | + | 0.8052 | 80.52% |
Aromatase binding | + | 0.6467 | 64.67% |
PPAR gamma | + | 0.7630 | 76.30% |
Honey bee toxicity | - | 0.8360 | 83.60% |
Biodegradation | - | 0.8000 | 80.00% |
Crustacea aquatic toxicity | + | 0.8913 | 89.13% |
Fish aquatic toxicity | + | 0.9837 | 98.37% |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
CHEMBL1293255 | P15428 | 15-hydroxyprostaglandin dehydrogenase [NAD+] |
35481.3 nM |
Potency |
via CMAUP
|
CHEMBL3577 | P00352 | Aldehyde dehydrogenase 1A1 |
39810.7 nM |
Potency |
via CMAUP
|
CHEMBL340 | P08684 | Cytochrome P450 3A4 |
6309.6 nM 6309.6 nM |
Potency Potency |
via CMAUP
via CMAUP |
CHEMBL4159 | Q99714 | Endoplasmic reticulum-associated amyloid beta-peptide-binding protein |
31622.8 nM |
Potency |
via CMAUP
|
CHEMBL1293226 | B2RXH2 | Lysine-specific demethylase 4D-like |
12589.3 nM |
Potency |
via CMAUP
|
CHEMBL4040 | P28482 | MAP kinase ERK2 |
2116 nM |
IC50 |
via CMAUP
|
CHEMBL1293224 | P10636 | Microtubule-associated protein tau |
12589.3 nM |
Potency |
via CMAUP
|
CHEMBL1293235 | P02545 | Prelamin-A/C |
2.2 nM |
Potency |
via Super-PRED
|
CHEMBL1697668 | Q9Y6L6 | Solute carrier organic anion transporter family member 1B1 |
2200 nM |
Ki |
PMID: 23571415
|
CHEMBL1743121 | Q9NPD5 | Solute carrier organic anion transporter family member 1B3 |
3820 nM |
Ki |
PMID: 23571415
|
CHEMBL1293232 | Q16637 | Survival motor neuron protein |
56.2 nM |
Potency |
via Super-PRED
|
CHEMBL1963 | P16473 | Thyroid stimulating hormone receptor |
794.3 nM |
Potency |
via Super-PRED
|
CHEMBL1075138 | Q9NUW8 | Tyrosyl-DNA phosphodiesterase 1 |
25118.9 nM |
Potency |
via CMAUP
|
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL2581 | P07339 | Cathepsin D | 98.53% | 98.95% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.02% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.88% | 96.09% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 95.43% | 91.49% |
CHEMBL1293267 | Q9HC97 | G-protein coupled receptor 35 | 94.74% | 89.34% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 94.17% | 99.17% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 93.24% | 95.56% |
CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 92.05% | 93.56% |
CHEMBL3401 | O75469 | Pregnane X receptor | 91.91% | 94.73% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 90.88% | 97.25% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 90.67% | 99.23% |
CHEMBL230 | P35354 | Cyclooxygenase-2 | 88.58% | 89.63% |
CHEMBL3891 | P07384 | Calpain 1 | 85.76% | 93.04% |
CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 84.28% | 94.33% |
CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 83.77% | 96.47% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 82.38% | 91.19% |
CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 81.64% | 93.03% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 80.65% | 100.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Allium ampeloprasum |
Artemisia gmelinii |
Drimia altissima |
Helenium amarum |
Scutellaria viscidula |
Senecio retrorsus |
Taxus wallichiana |
PubChem | 14957 |
NPASS | NPC95412 |
ChEMBL | CHEMBL211501 |