Antiarone G
Internal ID | 051b13b7-03c4-4dc4-84b9-65c40ba4e02d |
Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Flavans > 2-prenylated flavans > 2-prenylated flavanones |
IUPAC Name | 5,7-dihydroxy-2-[4-hydroxy-3-methoxy-2-(3-methylbut-2-enyl)phenyl]-8-(3-methylbut-2-enyl)-2,3-dihydrochromen-4-one |
SMILES (Canonical) | CC(=CCC1=C(C=CC(=C1OC)O)C2CC(=O)C3=C(C=C(C(=C3O2)CC=C(C)C)O)O)C |
SMILES (Isomeric) | CC(=CCC1=C(C=CC(=C1OC)O)C2CC(=O)C3=C(C=C(C(=C3O2)CC=C(C)C)O)O)C |
InChI | InChI=1S/C26H30O6/c1-14(2)6-8-17-16(10-11-19(27)25(17)31-5)23-13-22(30)24-21(29)12-20(28)18(26(24)32-23)9-7-15(3)4/h6-7,10-12,23,27-29H,8-9,13H2,1-5H3 |
InChI Key | CINHWJPZQLFMBC-UHFFFAOYSA-N |
Popularity | 1 reference in papers |
Molecular Formula | C26H30O6 |
Molecular Weight | 438.50 g/mol |
Exact Mass | 438.20423867 g/mol |
Topological Polar Surface Area (TPSA) | 96.20 Ų |
XlogP | 6.20 |
130756-20-6 |
5,7-Dihydroxy-2-(4-hydroxy-3-methoxy-2-(3-methyl-but-2-enyl)-phenyl)-8-((E)-3-methyl-but-2-enyl)-1-benzopyran-4-one |
5,7-Dihydroxy-2-[4-hydroxy-3-methoxy-2-(3-methyl-but-2-enyl)-phenyl]-8-((E)-3-methyl-but-2-enyl)-1-benzopyran-4-one |
DTXSID00926892 |
5,7-Dihydroxy-2-[4-hydroxy-3-methoxy-2-(3-methylbut-2-en-1-yl)phenyl]-8-(3-methylbut-2-en-1-yl)-2,3-dihydro-4H-1-benzopyran-4-one |
5,7-dihydroxy-2-[4-hydroxy-3-methoxy-2-(3-methylbut-2-enyl)phenyl]-8-(3-methylbut-2-enyl)chroman-4-one |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.40% | 91.11% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 97.61% | 94.45% |
CHEMBL2581 | P07339 | Cathepsin D | 92.41% | 98.95% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 92.15% | 96.09% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 91.74% | 86.33% |
CHEMBL3401 | O75469 | Pregnane X receptor | 91.03% | 94.73% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 90.97% | 95.56% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 89.80% | 85.14% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 89.35% | 99.15% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 86.63% | 99.17% |
CHEMBL2535 | P11166 | Glucose transporter | 86.11% | 98.75% |
CHEMBL1929 | P47989 | Xanthine dehydrogenase | 85.02% | 96.12% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 84.72% | 95.89% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 83.18% | 97.09% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 82.93% | 99.23% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 82.60% | 92.62% |
CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 82.22% | 93.40% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 81.33% | 89.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Antiaris toxicaria |
PubChem | 480772 |
LOTUS | LTS0272362 |
wikiData | Q82901497 |