Annosquatin-II, (rel)-
Internal ID | b7f81cc9-3d09-4319-a6ac-5548ab5a9be8 |
Taxonomy | Lipids and lipid-like molecules > Fatty Acyls > Fatty alcohols > Annonaceous acetogenins |
IUPAC Name | (2S)-4-[(2R)-14-[(2R,5S)-5-[(1S,4R)-1,4-dihydroxy-4-[(2S,5S)-5-[(1S)-1-hydroxyhexyl]oxolan-2-yl]butyl]oxolan-2-yl]-2-hydroxytetradecyl]-2-methyl-2H-furan-5-one |
SMILES (Canonical) | CCCCCC(C1CCC(O1)C(CCC(C2CCC(O2)CCCCCCCCCCCCC(CC3=CC(OC3=O)C)O)O)O)O |
SMILES (Isomeric) | CCCCC[C@@H]([C@@H]1CC[C@H](O1)[C@@H](CC[C@@H]([C@@H]2CC[C@H](O2)CCCCCCCCCCCC[C@H](CC3=C[C@@H](OC3=O)C)O)O)O)O |
InChI | InChI=1S/C37H66O8/c1-3-4-13-18-31(39)35-23-24-36(45-35)33(41)21-20-32(40)34-22-19-30(44-34)17-15-12-10-8-6-5-7-9-11-14-16-29(38)26-28-25-27(2)43-37(28)42/h25,27,29-36,38-41H,3-24,26H2,1-2H3/t27-,29+,30+,31-,32-,33+,34-,35-,36-/m0/s1 |
InChI Key | WAKFSRBZGHGMPD-OKPRCEDISA-N |
Popularity | 1 reference in papers |
Molecular Formula | C37H66O8 |
Molecular Weight | 638.90 g/mol |
Exact Mass | 638.47576906 g/mol |
Topological Polar Surface Area (TPSA) | 126.00 Ų |
XlogP | 8.20 |
Rel-Annosquatin-Ii |
Annosquatin-II, (rel)- |
CHEMBL1933124 |
Q27137322 |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL2581 | P07339 | Cathepsin D | 98.23% | 98.95% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 94.29% | 97.25% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 92.98% | 96.09% |
CHEMBL3401 | O75469 | Pregnane X receptor | 91.01% | 94.73% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 90.99% | 91.11% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 90.87% | 99.17% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 90.46% | 95.56% |
CHEMBL230 | P35354 | Cyclooxygenase-2 | 89.54% | 89.63% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 88.11% | 97.09% |
CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 87.09% | 93.56% |
CHEMBL4769 | O95749 | Geranylgeranyl pyrophosphate synthetase | 86.66% | 92.08% |
CHEMBL1907605 | P24864 | Cyclin-dependent kinase 2/cyclin E1 | 86.65% | 92.88% |
CHEMBL3892 | Q99500 | Sphingosine 1-phosphate receptor Edg-3 | 86.18% | 97.29% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 86.07% | 86.33% |
CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 86.06% | 100.00% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 83.67% | 90.71% |
CHEMBL2955 | O95136 | Sphingosine 1-phosphate receptor Edg-5 | 83.57% | 92.86% |
CHEMBL2996 | Q05655 | Protein kinase C delta | 83.18% | 97.79% |
CHEMBL5043 | Q6P179 | Endoplasmic reticulum aminopeptidase 2 | 82.28% | 91.81% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 81.99% | 99.23% |
CHEMBL1907 | P15144 | Aminopeptidase N | 80.01% | 93.31% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Annona squamosa |
PubChem | 57398789 |
LOTUS | LTS0050682 |
wikiData | Q27137322 |