Anhydrovariabilin
| Internal ID | a08b2648-b4af-4b63-a85a-522d301d1af9 |
| Taxonomy | Phenylpropanoids and polyketides > Isoflavonoids > Furanoisoflavonoids > Pterocarpans |
| IUPAC Name | 3,9-dimethoxy-6H-[1]benzofuro[3,2-c]chromene |
| SMILES (Canonical) | COC1=CC2=C(C=C1)C3=C(O2)C4=C(C=C(C=C4)OC)OC3 |
| SMILES (Isomeric) | COC1=CC2=C(C=C1)C3=C(O2)C4=C(C=C(C=C4)OC)OC3 |
| InChI | InChI=1S/C17H14O4/c1-18-10-4-6-13-15(7-10)20-9-14-12-5-3-11(19-2)8-16(12)21-17(13)14/h3-8H,9H2,1-2H3 |
| InChI Key | FLEXCYTURSFUNC-UHFFFAOYSA-N |
| Popularity | 4 references in papers |
| Molecular Formula | C17H14O4 |
| Molecular Weight | 282.29 g/mol |
| Exact Mass | 282.08920892 g/mol |
| Topological Polar Surface Area (TPSA) | 40.80 Ų |
| XlogP | 3.50 |
| 1433-08-5 |
| 3,9-Dimethoxypterocarpene |
| RefChem:1077000 |
| Dehydrovariabilin |
| 3,9-Dimethoxy-6H-benzofuro[3,2-c][1]benzopyran |
| 3,9-dimethoxy-6H-benzofuro[3,2-c]chromene |
| 3,9-Dimethoxy-6H-[1]benzofuro[3,2-c]chromene |
| KBio2_000462 |
| Spectrum_000062 |
| Spectrum2_000058 |
| There are more than 10 synonyms. If you wish to see them all click here. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.57% | 91.11% |
| CHEMBL2039 | P27338 | Monoamine oxidase B | 94.82% | 92.51% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 94.48% | 91.49% |
| CHEMBL1907 | P15144 | Aminopeptidase N | 94.30% | 93.31% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 92.98% | 97.09% |
| CHEMBL3231 | Q13464 | Rho-associated protein kinase 1 | 90.58% | 95.55% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 90.43% | 94.00% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 89.25% | 95.56% |
| CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 87.67% | 92.62% |
| CHEMBL4481 | P35228 | Nitric oxide synthase, inducible | 87.37% | 94.80% |
| CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 86.56% | 96.77% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 85.63% | 95.89% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 85.42% | 90.00% |
| CHEMBL3438 | Q05513 | Protein kinase C zeta | 84.70% | 88.48% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 84.30% | 89.00% |
| CHEMBL2581 | P07339 | Cathepsin D | 84.09% | 98.95% |
| CHEMBL2535 | P11166 | Glucose transporter | 83.57% | 98.75% |
| CHEMBL2292 | Q13627 | Dual-specificity tyrosine-phosphorylation regulated kinase 1A | 83.39% | 93.24% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 82.93% | 96.09% |
| CHEMBL4940 | P07195 | L-lactate dehydrogenase B chain | 81.51% | 95.53% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 80.68% | 100.00% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 80.14% | 96.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Dalbergia decipularis |
| Ononis viscosa |
| PubChem | 624785 |
| LOTUS | LTS0219770 |
| wikiData | Q104997008 |