Angelicoin B
Internal ID | 22ae5a44-2bf6-4f5d-855e-d8761f5014bd |
Taxonomy | Organoheterocyclic compounds > Benzopyrans > 2-benzopyrans |
IUPAC Name | (3S)-8-hydroxy-6-methoxy-3-methyl-3,4-dihydroisochromen-1-one |
SMILES (Canonical) | CC1CC2=C(C(=CC(=C2)OC)O)C(=O)O1 |
SMILES (Isomeric) | C[C@H]1CC2=C(C(=CC(=C2)OC)O)C(=O)O1 |
InChI | InChI=1S/C11H12O4/c1-6-3-7-4-8(14-2)5-9(12)10(7)11(13)15-6/h4-6,12H,3H2,1-2H3/t6-/m0/s1 |
InChI Key | AIFNAMVERSBWPS-LURJTMIESA-N |
Popularity | 2 references in papers |
Molecular Formula | C11H12O4 |
Molecular Weight | 208.21 g/mol |
Exact Mass | 208.07355886 g/mol |
Topological Polar Surface Area (TPSA) | 55.80 Ų |
XlogP | 2.40 |
(3S)-8-Hydroxy-6-methoxy-3-methyl-3,4-dihydroisochromen-1-one |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.19% | 91.11% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 96.40% | 95.56% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 93.95% | 85.14% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 90.19% | 99.23% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 89.56% | 96.09% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 89.28% | 94.00% |
CHEMBL2581 | P07339 | Cathepsin D | 89.23% | 98.95% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 88.27% | 99.15% |
CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 86.60% | 91.07% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 86.21% | 92.94% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 85.51% | 89.00% |
CHEMBL3401 | O75469 | Pregnane X receptor | 84.61% | 94.73% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 83.48% | 86.33% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 82.90% | 97.09% |
CHEMBL2535 | P11166 | Glucose transporter | 82.47% | 98.75% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 82.31% | 97.14% |
CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 81.74% | 93.40% |
CHEMBL2964 | P36507 | Dual specificity mitogen-activated protein kinase kinase 2 | 81.73% | 80.00% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 80.90% | 99.17% |
CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 80.14% | 93.99% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Daucus carota |
PubChem | 11629832 |
LOTUS | LTS0079914 |
wikiData | Q104912708 |