Ananolignan L
Internal ID | d70b8c2b-104e-4394-b8fe-1c9e4d3159b0 |
Taxonomy | Phenylpropanoids and polyketides > Tannins > Hydrolyzable tannins |
IUPAC Name | [(8R,9S,10R,11R)-11-acetyloxy-3,4,5,19-tetramethoxy-9,10-dimethyl-15,17-dioxatetracyclo[10.7.0.02,7.014,18]nonadeca-1(19),2,4,6,12,14(18)-hexaen-8-yl] (E)-2-methylbut-2-enoate |
SMILES (Canonical) | CC=C(C)C(=O)OC1C(C(C(C2=CC3=C(C(=C2C4=C(C(=C(C=C14)OC)OC)OC)OC)OCO3)OC(=O)C)C)C |
SMILES (Isomeric) | C/C=C(\C)/C(=O)O[C@@H]1[C@H]([C@H]([C@H](C2=CC3=C(C(=C2C4=C(C(=C(C=C14)OC)OC)OC)OC)OCO3)OC(=O)C)C)C |
InChI | InChI=1S/C30H36O10/c1-10-14(2)30(32)40-25-16(4)15(3)24(39-17(5)31)19-12-21-27(38-13-37-21)29(36-9)23(19)22-18(25)11-20(33-6)26(34-7)28(22)35-8/h10-12,15-16,24-25H,13H2,1-9H3/b14-10+/t15-,16+,24-,25-/m1/s1 |
InChI Key | HIGLJZHMTBHEQS-ULEIZWEFSA-N |
Popularity | 1 reference in papers |
Molecular Formula | C30H36O10 |
Molecular Weight | 556.60 g/mol |
Exact Mass | 556.23084734 g/mol |
Topological Polar Surface Area (TPSA) | 108.00 Ų |
XlogP | 5.30 |
CHEBI:67449 |
CHEMBL1782120 |
AKOS040763399 |
1280213-70-8 |
Q27135918 |
(5R,6S,7R,8R)-8-acetoxy-1,2,3,13-tetramethoxy-6,7-dimethyl-5,6,7,8-tetrahydrobenzo[3',4']cycloocta[1',2':4,5]benzo[1,2-d][1,3]dioxol-5-yl (2E)-2-methylbut-2-enoate |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
CHEMBL2392 | P06746 | DNA polymerase beta |
100 nM |
Potency |
via Super-PRED
|
CHEMBL5514 | P42858 | Huntingtin |
89.1 nM |
Potency |
via Super-PRED
|
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.85% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.59% | 96.09% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 94.13% | 94.45% |
CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 93.84% | 96.77% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 92.16% | 89.00% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 91.64% | 86.33% |
CHEMBL4225 | P49760 | Dual specificity protein kinase CLK2 | 89.64% | 80.96% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 89.46% | 92.62% |
CHEMBL2413 | P32246 | C-C chemokine receptor type 1 | 89.22% | 89.50% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 88.59% | 95.56% |
CHEMBL4481 | P35228 | Nitric oxide synthase, inducible | 87.84% | 94.80% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 87.76% | 99.17% |
CHEMBL5311 | P37023 | Serine/threonine-protein kinase receptor R3 | 84.89% | 82.67% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 84.21% | 97.25% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 83.11% | 91.19% |
CHEMBL2535 | P11166 | Glucose transporter | 81.57% | 98.75% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 81.30% | 100.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Kadsura coccinea |
PubChem | 53262699 |
LOTUS | LTS0130492 |
wikiData | Q27135918 |