Ananolignan D
Internal ID | a5d1e44c-16ad-43c7-86bd-dc3fc498c5af |
Taxonomy | Phenylpropanoids and polyketides > Tannins > Hydrolyzable tannins |
IUPAC Name | [(8S,9S,10R,11R)-8-hydroxy-3,4,5,19-tetramethoxy-9,10-dimethyl-15,17-dioxatetracyclo[10.7.0.02,7.014,18]nonadeca-1(19),2,4,6,12,14(18)-hexaen-11-yl] acetate |
SMILES (Canonical) | CC1C(C(C2=CC3=C(C(=C2C4=C(C(=C(C=C4C1O)OC)OC)OC)OC)OCO3)OC(=O)C)C |
SMILES (Isomeric) | C[C@H]1[C@H]([C@H](C2=CC3=C(C(=C2C4=C(C(=C(C=C4[C@H]1O)OC)OC)OC)OC)OCO3)OC(=O)C)C |
InChI | InChI=1S/C25H30O9/c1-11-12(2)21(34-13(3)26)15-9-17-23(33-10-32-17)25(31-7)19(15)18-14(20(11)27)8-16(28-4)22(29-5)24(18)30-6/h8-9,11-12,20-21,27H,10H2,1-7H3/t11-,12+,20-,21+/m0/s1 |
InChI Key | VMDLXEJHKASDPJ-YGGHMXSPSA-N |
Popularity | 1 reference in papers |
Molecular Formula | C25H30O9 |
Molecular Weight | 474.50 g/mol |
Exact Mass | 474.18898253 g/mol |
Topological Polar Surface Area (TPSA) | 102.00 Ų |
XlogP | 3.50 |
CHEBI:67441 |
CHEMBL1782112 |
Q27135908 |
(5S,6S,7R,8R)-5-Hydroxy-1,2,3,13-tetramethoxy-6,7-dimethyl-5,6,7,8-tetrahydrobenzo[3',4']cycloocta[1',2':4,5]benzo[1,2-d][1,3]dioxol-8-yl acetate |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.44% | 96.09% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.83% | 91.11% |
CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 95.83% | 96.77% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 94.62% | 94.45% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 91.70% | 85.14% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 91.47% | 86.33% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 89.79% | 89.00% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 89.35% | 95.89% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 89.21% | 92.62% |
CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 89.14% | 97.21% |
CHEMBL2413 | P32246 | C-C chemokine receptor type 1 | 88.77% | 89.50% |
CHEMBL5311 | P37023 | Serine/threonine-protein kinase receptor R3 | 88.47% | 82.67% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 87.67% | 99.17% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 86.43% | 97.25% |
CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 85.58% | 96.95% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 85.45% | 91.19% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 84.78% | 95.56% |
CHEMBL4481 | P35228 | Nitric oxide synthase, inducible | 84.14% | 94.80% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 83.29% | 100.00% |
CHEMBL4247 | Q9UM73 | ALK tyrosine kinase receptor | 81.33% | 96.86% |
CHEMBL4225 | P49760 | Dual specificity protein kinase CLK2 | 81.22% | 80.96% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Kadsura coccinea |
PubChem | 53355341 |
LOTUS | LTS0229319 |
wikiData | Q27135908 |