Amurensin K
Internal ID | df7f8e54-dbeb-4ce0-bf2a-323027743cac |
Taxonomy | Phenylpropanoids and polyketides > 2-arylbenzofuran flavonoids |
IUPAC Name | (1S,8S,9R,16S)-9-[5-[(7S,8S)-8-(3,5-dihydroxyphenyl)-4-hydroxy-7-(4-hydroxyphenyl)-7,8-dihydrofuro[3,2-e][1]benzofuran-2-yl]-2-hydroxyphenyl]-8,16-bis(4-hydroxyphenyl)-15-oxatetracyclo[8.6.1.02,7.014,17]heptadeca-2(7),3,5,10(17),11,13-hexaene-4,6,12-triol |
SMILES (Canonical) | C1=CC(=CC=C1C2C(C3=C4C(C(OC4=CC(=C3)O)C5=CC=C(C=C5)O)C6=C2C(=CC(=C6)O)O)C7=C(C=CC(=C7)C8=CC9=C(O8)C(=CC1=C9C(C(O1)C1=CC=C(C=C1)O)C1=CC(=CC(=C1)O)O)O)O)O |
SMILES (Isomeric) | C1=CC(=CC=C1[C@@H]2[C@H](C3=C4[C@@H]([C@H](OC4=CC(=C3)O)C5=CC=C(C=C5)O)C6=C2C(=CC(=C6)O)O)C7=C(C=CC(=C7)C8=CC9=C(O8)C(=CC1=C9[C@@H]([C@H](O1)C1=CC=C(C=C1)O)C1=CC(=CC(=C1)O)O)O)O)O |
InChI | InChI=1S/C56H40O13/c57-30-8-1-25(2-9-30)47-49(38-20-36(63)22-45-51(38)53(39-19-35(62)21-42(65)50(39)47)55(68-45)27-5-12-32(59)13-6-27)37-17-28(7-14-41(37)64)44-23-40-52-46(24-43(66)56(40)67-44)69-54(26-3-10-31(58)11-4-26)48(52)29-15-33(60)18-34(61)16-29/h1-24,47-49,53-55,57-66H/t47-,48+,49+,53+,54-,55-/m1/s1 |
InChI Key | KYCWATKXJOSHQR-KPXHRNBCSA-N |
Popularity | 0 references in papers |
Molecular Formula | C56H40O13 |
Molecular Weight | 920.90 g/mol |
Exact Mass | 920.24689133 g/mol |
Topological Polar Surface Area (TPSA) | 234.00 Ų |
XlogP | 9.60 |
37E366SR4Q |
388121-56-0 |
Rel-(+)-(1R,6S,7R,11bR)-6-(5-((7R,8R)-8-(3,5-dihydroxyphenyl)-7,8-dihydro-4-hydroxy-7-(4-hydroxyphenyl)benzo(1,2-b:4,3-b)difuran-2-yl)-2-hydroxyphenyl)-1,6,7,11b-tetrahydro-1,7-bis(4-hydroxyphenyl)benzo(6,7)cyclohepta(1,2,3-cd)benzofuran-4,8,10-triol |
(1S,6R,7S,11bS)-6-(5-((7S,8S)-8-(3,5-Dihydroxyphenyl)-4-hydroxy-7-(4-hydroxyphenyl)-7,8-dihydrobenzo(1,2-b:4,3-b')difuran-2-yl)-2-hydroxyphenyl)-1,7-bis(4-hydroxyphenyl)-1,6,7,11b-tetrahydrobenzo(6,7)cyclohepta(1,2,3-cd)(1)benzofuran-4,8,10-triol |
(1S,6R,7S,11bS)-6-{5-[(7S,8S)-8-(3,5-Dihydroxyphenyl)-4-hydroxy-7-(4-hydroxyphenyl)-7,8-dihydrobenzo[1,2-b:4,3-b']difuran-2-yl]-2-hydroxyphenyl}-1,7-bis(4-hydroxyphenyl)-1,6,7,11b-tetrahydrobenzo[6,7]cyclohepta[1,2,3-cd][1]benzofuran-4,8,10-triol |
UNII-37E366SR4Q |
DTXSID801045300 |
Q4748993 |
BENZO(6,7)CYCLOHEPTA(1,2,3-CD)BENZOFURAN-4,8,10-TRIOL, 6-(5-((7R,8R)-8-(3,5-DIHYDROXYPHENYL)-7,8-DIHYDRO-4-HYDROXY-7-(4-HYDROXYPHENYL)BENZO(1,2-B:4,3-B)DIFURAN-2-YL)-2-HYDROXYPHENYL)-1,6,7,11B-TETRAHYDRO-1,7-BIS(4-HYDROXYPHENYL)-, (1R,6S,7R,11BR)-REL-(+)- |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.93% | 91.11% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 97.91% | 99.15% |
CHEMBL242 | Q92731 | Estrogen receptor beta | 96.18% | 98.35% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 94.62% | 91.49% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 94.05% | 89.00% |
CHEMBL3713062 | P10646 | Tissue factor pathway inhibitor | 90.30% | 97.33% |
CHEMBL2581 | P07339 | Cathepsin D | 89.83% | 98.95% |
CHEMBL5339 | Q5NUL3 | G-protein coupled receptor 120 | 88.17% | 95.78% |
CHEMBL3227 | P41594 | Metabotropic glutamate receptor 5 | 87.36% | 96.42% |
CHEMBL2107 | P61073 | C-X-C chemokine receptor type 4 | 86.17% | 93.10% |
CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 85.29% | 91.71% |
CHEMBL3438 | Q05513 | Protein kinase C zeta | 85.23% | 88.48% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 84.19% | 99.23% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 83.70% | 94.45% |
CHEMBL1293255 | P15428 | 15-hydroxyprostaglandin dehydrogenase [NAD+] | 83.05% | 83.57% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 82.81% | 95.56% |
CHEMBL4530 | P00488 | Coagulation factor XIII | 82.57% | 96.00% |
CHEMBL344 | Q99705 | Melanin-concentrating hormone receptor 1 | 82.45% | 92.50% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 82.35% | 99.17% |
CHEMBL3194 | P02766 | Transthyretin | 82.34% | 90.71% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 82.26% | 94.00% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 81.59% | 85.14% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 80.64% | 92.94% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Vitis amurensis |
PubChem | 16131909 |
LOTUS | LTS0215990 |
wikiData | Q4748993 |