Aminoglutethimide
| Internal ID | 4b49cfae-6acf-4fb3-8fa7-54fa2e2cc2a5 |
| Taxonomy | Benzenoids > Benzene and substituted derivatives > Aniline and substituted anilines |
| IUPAC Name | 3-(4-aminophenyl)-3-ethylpiperidine-2,6-dione |
| SMILES (Canonical) | |
| SMILES (Isomeric) | |
| InChI | InChI=1S/C13H16N2O2/c1-2-13(8-7-11(16)15-12(13)17)9-3-5-10(14)6-4-9/h3-6H,2,7-8,14H2,1H3,(H,15,16,17) |
| InChI Key | ROBVIMPUHSLWNV-UHFFFAOYSA-N |
| Popularity | 3,260 references in papers |
| Molecular Formula | C13H16N2O2 |
| Molecular Weight | 232.28 g/mol |
| Exact Mass | 232.121177757 g/mol |
| Topological Polar Surface Area (TPSA) | 72.20 Ų |
| XlogP | 1.20 |
| Atomic LogP (AlogP) | 1.35 |
| H-Bond Acceptor | 3 |
| H-Bond Donor | 2 |
| Rotatable Bonds | 2 |
| 125-84-8 |
| dl-Aminoglutethimide |
| Cytadren |
| Orimeten |
| p-Aminoglutethimide |
| Elipten |
| 3-(4-aminophenyl)-3-ethylpiperidine-2,6-dione |
| Aminoglutetimida |
| 2,6-Piperidinedione, 3-(4-aminophenyl)-3-ethyl- |
| 3-(4-Aminophenyl)-3-ethyl-2,6-piperidinedione |
| There are more than 10 synonyms. If you wish to see them all click here. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| Human Intestinal Absorption | + | 0.9900 | 99.00% |
| Caco-2 | + | 0.6480 | 64.80% |
| Blood Brain Barrier | + | 1.0000 | 100.00% |
| Human oral bioavailability | + | 0.9143 | 91.43% |
| Subcellular localzation | Mitochondria | 0.5887 | 58.87% |
| OATP2B1 inhibitior | - | 1.0000 | 100.00% |
| OATP1B1 inhibitior | + | 0.9573 | 95.73% |
| OATP1B3 inhibitior | + | 0.9479 | 94.79% |
| MATE1 inhibitior | - | 0.9200 | 92.00% |
| OCT2 inhibitior | - | 0.8500 | 85.00% |
| BSEP inhibitior | - | 0.8945 | 89.45% |
| P-glycoprotein inhibitior | - | 0.9892 | 98.92% |
| P-glycoprotein substrate | - | 0.7343 | 73.43% |
| CYP3A4 substrate | - | 0.7908 | 79.08% |
| CYP2C9 substrate | - | 1.0000 | 100.00% |
| CYP2D6 substrate | - | 0.7581 | 75.81% |
| CYP3A4 inhibition | - | 0.8309 | 83.09% |
| CYP2C9 inhibition | - | 0.9071 | 90.71% |
| CYP2C19 inhibition | - | 0.9026 | 90.26% |
| CYP2D6 inhibition | - | 0.9230 | 92.30% |
| CYP1A2 inhibition | - | 0.9045 | 90.45% |
| CYP2C8 inhibition | - | 0.9586 | 95.86% |
| CYP inhibitory promiscuity | - | 0.8682 | 86.82% |
| UGT catelyzed | - | 0.0000 | 0.00% |
| Carcinogenicity (binary) | - | 0.7800 | 78.00% |
| Carcinogenicity (trinary) | Non-required | 0.5236 | 52.36% |
| Eye corrosion | - | 0.9892 | 98.92% |
| Eye irritation | - | 0.9724 | 97.24% |
| Skin irritation | - | 0.7854 | 78.54% |
| Skin corrosion | - | 0.9113 | 91.13% |
| Ames mutagenesis | + | 0.5446 | 54.46% |
| Human Ether-a-go-go-Related Gene inhibition | - | 0.6895 | 68.95% |
| Micronuclear | + | 0.7100 | 71.00% |
| Hepatotoxicity | - | 0.6979 | 69.79% |
| skin sensitisation | - | 0.8878 | 88.78% |
| Respiratory toxicity | + | 0.9333 | 93.33% |
| Reproductive toxicity | + | 0.9333 | 93.33% |
| Mitochondrial toxicity | + | 0.8875 | 88.75% |
| Nephrotoxicity | - | 0.8449 | 84.49% |
| Acute Oral Toxicity (c) | III | 0.6711 | 67.11% |
| Estrogen receptor binding | - | 0.5357 | 53.57% |
| Androgen receptor binding | + | 0.5723 | 57.23% |
| Thyroid receptor binding | - | 0.5732 | 57.32% |
| Glucocorticoid receptor binding | - | 0.5331 | 53.31% |
| Aromatase binding | + | 0.5557 | 55.57% |
| PPAR gamma | - | 0.5543 | 55.43% |
| Honey bee toxicity | - | 0.9435 | 94.35% |
| Biodegradation | - | 0.7250 | 72.50% |
| Crustacea aquatic toxicity | - | 0.5000 | 50.00% |
| Fish aquatic toxicity | - | 0.3899 | 38.99% |
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| CHEMBL1978 | P11511 | Cytochrome P450 19A1 |
18500 nM 5200 nM 29750 nM 14000 nM 10000 nM 270 nM 30000 nM 6400 nM 18500 nM 30000 nM 5.2 nM 6130 nM 8300 nM 2800 nM 270 nM 10000 nM 13000 nM 6400 nM 5800 nM 5200 nM 2800 nM 1900 nM 1900 nM 18500 nM 28500 nM 18500 nM 8000 nM 1700 nM 29750 nM 14000 nM 28500 nM 8000 nM |
IC50 IC50 IC50 IC50 IC50 IC50 IC50 IC50 IC50 IC50 IC50 IC50 IC50 IC50 IC50 IC50 IC50 IC50 IC50 IC50 IC50 IC50 IC50 IC50 IC50 IC50 IC50 IC50 IC50 IC50 IC50 IC50 |
PMID: 21126094
PMID: 8350094 PMID: 21865046 PMID: 22413911 PMID: 24224843 PMID: 24359303 PMID: 24998377 PMID: 26087936 PMID: 27142753 via CMAUP via CMAUP via CMAUP via CMAUP via CMAUP via CMAUP via CMAUP PMID: 17190442 PMID: 10328294 PMID: 9651160 PMID: 9514009 PMID: 20359898 PMID: 12217376 PMID: 15043408 PMID: 15456257 PMID: 15787431 PMID: 17420206 PMID: 17489632 PMID: 18077425 PMID: 18426954 PMID: 19072214 PMID: 19332671 PMID: 20014752 |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 |
31622.8 nM 31622.8 nM |
Potency Potency |
PMID: 12067541
PMID: 8021914 |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit |
251.2 nM |
Potency |
via Super-PRED
|
| CHEMBL1835 | P24557 | Thromboxane-A synthase |
18500 nM |
IC50 |
PMID: 19902967
|
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 92.78% | 95.56% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 92.04% | 94.45% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 91.83% | 97.09% |
| CHEMBL2581 | P07339 | Cathepsin D | 90.43% | 98.95% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 89.36% | 91.11% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 86.26% | 94.75% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 85.95% | 97.25% |
| CHEMBL255 | P29275 | Adenosine A2b receptor | 82.86% | 98.59% |
| CHEMBL1287628 | Q9Y5S8 | NADPH oxidase 1 | 81.36% | 95.48% |
| CHEMBL226 | P30542 | Adenosine A1 receptor | 80.96% | 95.93% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 80.31% | 100.00% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 80.06% | 95.89% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Broussonetia papyrifera |