altersolanol K
Internal ID | a3e9720d-6bd2-4c24-9dc5-56c2d913cc54 |
Taxonomy | Benzenoids > Anthracenes |
IUPAC Name | (1R,2R,3R,4aS,9aR,10R)-1,2,3,5,10-pentahydroxy-7-methoxy-2-methyl-1,3,4,4a,9a,10-hexahydroanthracen-9-one |
SMILES (Canonical) | CC1(C(CC2C(C1O)C(=O)C3=C(C2O)C(=CC(=C3)OC)O)O)O |
SMILES (Isomeric) | C[C@]1([C@@H](C[C@H]2[C@H]([C@H]1O)C(=O)C3=C([C@@H]2O)C(=CC(=C3)OC)O)O)O |
InChI | InChI=1S/C16H20O7/c1-16(22)10(18)5-8-12(15(16)21)14(20)7-3-6(23-2)4-9(17)11(7)13(8)19/h3-4,8,10,12-13,15,17-19,21-22H,5H2,1-2H3/t8-,10+,12-,13+,15+,16+/m0/s1 |
InChI Key | WCDSEXBCUGEBMO-YFVPKAEFSA-N |
Popularity | 2 references in papers |
Molecular Formula | C16H20O7 |
Molecular Weight | 324.32 g/mol |
Exact Mass | 324.12090297 g/mol |
Topological Polar Surface Area (TPSA) | 127.00 Ų |
XlogP | -1.10 |
SCHEMBL904367 |
CHEMBL552249 |
![2D Structure of altersolanol K 2D Structure of altersolanol K](https://plantaedb.com/storage/docs/compounds/2023/11/altersolanol-k.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.11% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 93.88% | 96.09% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 93.37% | 95.56% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 92.93% | 97.09% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 89.40% | 99.15% |
CHEMBL2581 | P07339 | Cathepsin D | 88.59% | 98.95% |
CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 87.93% | 96.95% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 86.80% | 91.19% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 86.21% | 86.33% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 85.59% | 94.00% |
CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 85.44% | 93.40% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 84.46% | 85.14% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 82.86% | 99.23% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 82.72% | 89.00% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 82.69% | 95.89% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 82.36% | 92.94% |
CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 82.24% | 91.07% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 81.79% | 94.45% |
CHEMBL2535 | P11166 | Glucose transporter | 81.47% | 98.75% |
CHEMBL3864 | Q06124 | Protein-tyrosine phosphatase 2C | 80.97% | 94.42% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Mentha pulegium |
PubChem | 42639665 |
LOTUS | LTS0077166 |
wikiData | Q77371500 |