Alstoumerine
Internal ID | 35e76c2b-6ad6-4df5-be83-517ea76f7569 |
Taxonomy | Alkaloids and derivatives > Macroline alkaloids |
IUPAC Name | (1S)-1-[(1S,12S,13R,14S)-13-(hydroxymethyl)-3-methyl-3,17-diazapentacyclo[12.3.1.02,10.04,9.012,17]octadeca-2(10),4,6,8,15-pentaen-15-yl]ethanol |
SMILES (Canonical) | CC(C1=CN2C3CC1C(C2CC4=C3N(C5=CC=CC=C45)C)CO)O |
SMILES (Isomeric) | C[C@@H](C1=CN2[C@H]3C[C@H]1[C@H]([C@@H]2CC4=C3N(C5=CC=CC=C45)C)CO)O |
InChI | InChI=1S/C20H24N2O2/c1-11(24)15-9-22-18-8-14-12-5-3-4-6-17(12)21(2)20(14)19(22)7-13(15)16(18)10-23/h3-6,9,11,13,16,18-19,23-24H,7-8,10H2,1-2H3/t11-,13+,16+,18-,19-/m0/s1 |
InChI Key | LWSDVTSJDOUAFK-MHAZOHMYSA-N |
Popularity | 2 references in papers |
Molecular Formula | C20H24N2O2 |
Molecular Weight | 324.40 g/mol |
Exact Mass | 324.183778013 g/mol |
Topological Polar Surface Area (TPSA) | 48.60 Ų |
XlogP | 1.30 |
alstoumerine |
CHEMBL3338255 |
Q27137487 |
![2D Structure of Alstoumerine 2D Structure of Alstoumerine](https://plantaedb.com/storage/docs/compounds/2023/11/alstoumerine.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 98.60% | 97.25% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.24% | 96.09% |
CHEMBL2581 | P07339 | Cathepsin D | 95.08% | 98.95% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 93.92% | 95.56% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 93.81% | 85.14% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 91.89% | 91.11% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 90.79% | 91.49% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 89.98% | 95.93% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 89.09% | 89.00% |
CHEMBL3476 | O15111 | Inhibitor of nuclear factor kappa B kinase alpha subunit | 87.81% | 95.83% |
CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 85.00% | 93.99% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 83.50% | 97.09% |
CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 83.06% | 90.08% |
CHEMBL255 | P29275 | Adenosine A2b receptor | 82.91% | 98.59% |
CHEMBL2535 | P11166 | Glucose transporter | 81.24% | 98.75% |
CHEMBL2335 | P42785 | Lysosomal Pro-X carboxypeptidase | 80.78% | 100.00% |
CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 80.32% | 93.56% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Alstonia angustifolia |
Alstonia macrophylla |
PubChem | 56926393 |
LOTUS | LTS0119726 |
wikiData | Q105266826 |