alpha-Bulnesene
| Internal ID | cd9af0db-0a76-49e2-9f64-8ce63a73d20c |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Sesquiterpenoids |
| IUPAC Name | 3,8-dimethyl-5-prop-1-en-2-yl-1,2,3,3a,4,5,6,7-octahydroazulene |
| SMILES (Canonical) | CC1CCC2=C(CCC(CC12)C(=C)C)C |
| SMILES (Isomeric) | CC1CCC2=C(CCC(CC12)C(=C)C)C |
| InChI | InChI=1S/C15H24/c1-10(2)13-7-5-11(3)14-8-6-12(4)15(14)9-13/h12-13,15H,1,5-9H2,2-4H3 |
| InChI Key | YHAJBLWYOIUHHM-UHFFFAOYSA-N |
| Popularity | 8 references in papers |
| Molecular Formula | C15H24 |
| Molecular Weight | 204.35 g/mol |
| Exact Mass | 204.187800766 g/mol |
| Topological Polar Surface Area (TPSA) | 0.00 Ų |
| XlogP | 4.60 |
| alpha-Bulnesene |
| a-Bulnesene |
| D-Guaiene |
| bulnesene (alpha-) |
| laquo deltaRaquo -guaiene |
| laquo deltaRaquo -guaijene |
| DTXSID00863253 |
| YHAJBLWYOIUHHM-UHFFFAOYSA-N |
| 3,8-dimethyl-5-prop-1-en-2-yl-1,2,3,3a,4,5,6,7-octahydroazulene |
| laquo deltaRaquo -guaiene (alpha-bulnesene) |
| There are more than 10 synonyms. If you wish to see them all click here. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL1951 | P21397 | Monoamine oxidase A | 92.85% | 91.49% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 88.47% | 96.09% |
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 88.39% | 83.82% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 88.04% | 91.11% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 86.14% | 97.09% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 83.61% | 92.94% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 83.26% | 95.56% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 83.10% | 100.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Callitris columellaris |
| Cinnamomum camphora |
| Pogostemon cablin |
| Rugelia nudicaulis |
| Seriphidium baldshuanicum |
| PubChem | 520826 |
| LOTUS | LTS0192721 |
| wikiData | Q105348323 |