Alliumoside A
Internal ID | 7795d389-7a7e-4a83-be70-1a452fe1b1a3 |
Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Flavonoid glycosides > Flavonoid O-glycosides |
IUPAC Name | 3,5,7-trihydroxy-2-[3-methoxy-4-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]chromen-4-one |
SMILES (Canonical) | COC1=C(C=CC(=C1)C2=C(C(=O)C3=C(C=C(C=C3O2)O)O)O)OC4C(C(C(C(O4)CO)O)O)O |
SMILES (Isomeric) | COC1=C(C=CC(=C1)C2=C(C(=O)C3=C(C=C(C=C3O2)O)O)O)OC4C(C(C(C(O4)CO)O)O)O |
InChI | InChI=1S/C22H22O12/c1-31-12-4-8(21-19(29)17(27)15-10(25)5-9(24)6-13(15)32-21)2-3-11(12)33-22-20(30)18(28)16(26)14(7-23)34-22/h2-6,14,16,18,20,22-26,28-30H,7H2,1H3 |
InChI Key | VTDBDVABTGGRMO-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C22H22O12 |
Molecular Weight | 478.40 g/mol |
Exact Mass | 478.11112613 g/mol |
Topological Polar Surface Area (TPSA) | 196.00 Ų |
XlogP | 0.70 |
There are no found synonyms. |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.73% | 91.11% |
CHEMBL2581 | P07339 | Cathepsin D | 96.91% | 98.95% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 96.85% | 89.00% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 96.70% | 94.00% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 94.99% | 96.09% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 93.81% | 86.33% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 90.96% | 99.17% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 90.80% | 86.92% |
CHEMBL3194 | P02766 | Transthyretin | 89.89% | 90.71% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 89.11% | 91.49% |
CHEMBL3401 | O75469 | Pregnane X receptor | 88.74% | 94.73% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 88.32% | 95.56% |
CHEMBL5339 | Q5NUL3 | G-protein coupled receptor 120 | 86.79% | 95.78% |
CHEMBL2345 | P51812 | Ribosomal protein S6 kinase alpha 3 | 86.47% | 95.64% |
CHEMBL220 | P22303 | Acetylcholinesterase | 84.91% | 94.45% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 84.35% | 92.94% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 83.82% | 96.00% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 82.75% | 94.45% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 82.56% | 95.89% |
CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 82.22% | 96.21% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 80.28% | 99.15% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 80.17% | 90.71% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Allium ascalonicum |
Lysimachia thyrsiflora |
PubChem | 73157059 |
LOTUS | LTS0089799 |
wikiData | Q105292663 |