Aliarin 4'-methyl ether
Internal ID | 17d54868-dc5b-42d0-b347-983f2d832aab |
Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Flavones > 3-prenylated flavones |
IUPAC Name | 5,7-dihydroxy-2-[3-(3-hydroxy-3-methylbutyl)-4-methoxyphenyl]-3,6-dimethoxychromen-4-one |
SMILES (Canonical) | CC(C)(CCC1=C(C=CC(=C1)C2=C(C(=O)C3=C(O2)C=C(C(=C3O)OC)O)OC)OC)O |
SMILES (Isomeric) | CC(C)(CCC1=C(C=CC(=C1)C2=C(C(=O)C3=C(O2)C=C(C(=C3O)OC)O)OC)OC)O |
InChI | InChI=1S/C23H26O8/c1-23(2,27)9-8-12-10-13(6-7-15(12)28-3)20-22(30-5)19(26)17-16(31-20)11-14(24)21(29-4)18(17)25/h6-7,10-11,24-25,27H,8-9H2,1-5H3 |
InChI Key | DKLGTRLGRWKLHB-UHFFFAOYSA-N |
Popularity | 1 reference in papers |
Molecular Formula | C23H26O8 |
Molecular Weight | 430.40 g/mol |
Exact Mass | 430.16276778 g/mol |
Topological Polar Surface Area (TPSA) | 115.00 Ų |
XlogP | 3.70 |
LMPK12112856 |
AKOS032948938 |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.03% | 91.11% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 97.12% | 94.00% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 96.86% | 86.33% |
CHEMBL2581 | P07339 | Cathepsin D | 94.75% | 98.95% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 94.51% | 89.00% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 90.17% | 85.14% |
CHEMBL3401 | O75469 | Pregnane X receptor | 88.59% | 94.73% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 87.99% | 94.45% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 87.42% | 99.17% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 87.19% | 96.09% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 85.90% | 99.15% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 84.96% | 95.56% |
CHEMBL3194 | P02766 | Transthyretin | 84.10% | 90.71% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 83.83% | 92.62% |
CHEMBL1255126 | O15151 | Protein Mdm4 | 83.19% | 90.20% |
CHEMBL2085 | P14174 | Macrophage migration inhibitory factor | 82.79% | 80.78% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 81.92% | 86.92% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Dodonaea viscosa |
Duranta erecta |
PubChem | 44259768 |
LOTUS | LTS0010672 |
wikiData | Q104983442 |