Albopilosin J
| Internal ID | 819dd4f1-1cf5-43c4-8e19-78b03c5d749f |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Terpene glycosides > Diterpene glycosides |
| IUPAC Name | (1R,2R,4S,5S,9R,10S,12S,13R,14R,16R)-2,12,16-trihydroxy-5,9,14-trimethyl-5-[[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxymethyl]tetracyclo[11.2.1.01,10.04,9]hexadecan-15-one |
| SMILES (Canonical) | CC1C2C(CC3C4(CCCC(C4CC(C3(C2O)C1=O)O)(C)COC5C(C(C(C(O5)CO)O)O)O)C)O |
| SMILES (Isomeric) | C[C@@H]1[C@@H]2[C@H](C[C@H]3[C@@]4(CCC[C@]([C@H]4C[C@H]([C@]3([C@@H]2O)C1=O)O)(C)CO[C@H]5[C@@H]([C@H]([C@@H]([C@H](O5)CO)O)O)O)C)O |
| InChI | InChI=1S/C26H42O10/c1-11-17-12(28)7-15-25(3)6-4-5-24(2,14(25)8-16(29)26(15,21(11)33)22(17)34)10-35-23-20(32)19(31)18(30)13(9-27)36-23/h11-20,22-23,27-32,34H,4-10H2,1-3H3/t11-,12+,13-,14-,15+,16-,17-,18-,19+,20-,22-,23-,24-,25-,26+/m1/s1 |
| InChI Key | JQJBEHOGHZETSG-IWHWUFCXSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C26H42O10 |
| Molecular Weight | 514.60 g/mol |
| Exact Mass | 514.27779753 g/mol |
| Topological Polar Surface Area (TPSA) | 177.00 Ų |
| XlogP | -0.50 |
| (1R,2R,4S,5S,9R,10S,12S,13R,14R,16R)-2,12,16-trihydroxy-5,9,14-trimethyl-5-(((2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl)oxymethyl)tetracyclo(11.2.1.01,10.04,9)hexadecan-15-one |
| (1R,2R,4S,5S,9R,10S,12S,13R,14R,16R)-2,12,16-trihydroxy-5,9,14-trimethyl-5-[[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxymethyl]tetracyclo[11.2.1.01,10.04,9]hexadecan-15-one |
| RefChem:110582 |
| 871566-45-9 |
| CHEMBL463147 |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.68% | 91.11% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 93.68% | 97.09% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 93.48% | 94.75% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 92.80% | 96.09% |
| CHEMBL2581 | P07339 | Cathepsin D | 90.47% | 98.95% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 88.81% | 85.14% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 87.01% | 95.56% |
| CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 86.31% | 90.08% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 86.09% | 86.33% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 85.91% | 95.89% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 84.65% | 89.00% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 83.92% | 94.00% |
| CHEMBL5255 | O00206 | Toll-like receptor 4 | 83.67% | 92.50% |
| CHEMBL220 | P22303 | Acetylcholinesterase | 83.49% | 94.45% |
| CHEMBL299 | P17252 | Protein kinase C alpha | 83.25% | 98.03% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 83.21% | 100.00% |
| CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 83.11% | 86.92% |
| CHEMBL3476 | O15111 | Inhibitor of nuclear factor kappa B kinase alpha subunit | 82.92% | 95.83% |
| CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 82.29% | 95.50% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 81.13% | 97.25% |
| CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 80.73% | 95.50% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 80.72% | 94.45% |
| CHEMBL3351 | Q13085 | Acetyl-CoA carboxylase 1 | 80.24% | 93.04% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Isodon albopilosus |
| PubChem | 11720463 |
| LOTUS | LTS0085550 |
| wikiData | Q105133508 |