Albinoside III
Internal ID | 4dcb64e9-6a8e-49e3-b5fb-187287b70295 |
Taxonomy | Lipids and lipid-like molecules > Saccharolipids |
IUPAC Name | [(2R,3R,4S,5R,6R)-2-[[(1S,3R,4S,5S,6R,8R,10S,22S,23R,24R,26R)-26-[(2S,3R,4R,5R,6S)-4,5-dihydroxy-6-methyl-3-[(E)-2-methylbut-2-enoyl]oxyoxan-2-yl]oxy-4,5,23-trihydroxy-6-methyl-20-oxo-10-pentyl-2,7,9,21,25-pentaoxatricyclo[20.3.1.03,8]hexacosan-24-yl]methoxy]-5-hydroxy-6-methyl-3-[(2S,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyoxan-4-yl] (E)-2-methylbut-2-enoate |
SMILES (Canonical) | CCCCCC1CCCCCCCCCC(=O)OC2C(C(OC(C2OC3C(C(C(C(O3)C)O)O)OC(=O)C(=CC)C)OC4C(C(C(OC4O1)C)O)O)COC5C(C(C(C(O5)C)O)OC(=O)C(=CC)C)OC6C(C(C(C(O6)C)O)O)O)O |
SMILES (Isomeric) | CCCCC[C@H]1CCCCCCCCCC(=O)O[C@H]2[C@@H]([C@H](O[C@H]([C@@H]2O[C@H]3[C@@H]([C@@H]([C@H]([C@@H](O3)C)O)O)OC(=O)/C(=C/C)/C)O[C@@H]4[C@H]([C@@H]([C@H](O[C@H]4O1)C)O)O)CO[C@H]5[C@@H]([C@H]([C@@H]([C@H](O5)C)O)OC(=O)/C(=C/C)/C)O[C@H]6[C@@H]([C@@H]([C@H]([C@@H](O6)C)O)O)O)O |
InChI | InChI=1S/C56H92O25/c1-10-13-19-22-32-23-20-17-15-14-16-18-21-24-34(57)76-45-39(62)33(25-69-53-48(80-52-43(66)40(63)35(58)28(6)70-52)44(38(61)31(9)71-53)77-50(67)26(4)11-2)75-56(79-47-42(65)37(60)29(7)72-54(47)74-32)49(45)81-55-46(78-51(68)27(5)12-3)41(64)36(59)30(8)73-55/h11-12,28-33,35-49,52-56,58-66H,10,13-25H2,1-9H3/b26-11+,27-12+/t28-,29+,30-,31+,32-,33+,35-,36-,37+,38+,39+,40+,41+,42-,43+,44-,45-,46+,47+,48+,49+,52-,53+,54-,55-,56-/m0/s1 |
InChI Key | HUCKMCHVBAWQIA-DGBHNKMOSA-N |
Popularity | 1 reference in papers |
Molecular Formula | C56H92O25 |
Molecular Weight | 1165.30 g/mol |
Exact Mass | 1164.59276842 g/mol |
Topological Polar Surface Area (TPSA) | 353.00 Ų |
XlogP | 3.00 |
CHEMBL2146620 |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL2581 | P07339 | Cathepsin D | 98.16% | 98.95% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.81% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 94.65% | 96.09% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 93.15% | 89.00% |
CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 92.50% | 100.00% |
CHEMBL5957 | P21589 | 5'-nucleotidase | 91.61% | 97.78% |
CHEMBL4462 | Q8IXJ6 | NAD-dependent deacetylase sirtuin 2 | 91.42% | 90.24% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 90.79% | 99.17% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 90.50% | 92.62% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 90.43% | 92.50% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 89.58% | 97.25% |
CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 89.51% | 95.50% |
CHEMBL3475 | P05121 | Plasminogen activator inhibitor-1 | 88.86% | 83.00% |
CHEMBL3401 | O75469 | Pregnane X receptor | 88.75% | 94.73% |
CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 88.65% | 94.33% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 88.57% | 91.19% |
CHEMBL1968 | P07099 | Epoxide hydrolase 1 | 86.48% | 98.57% |
CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 85.95% | 93.56% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 85.71% | 86.33% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 83.23% | 95.89% |
CHEMBL3351 | Q13085 | Acetyl-CoA carboxylase 1 | 82.52% | 93.04% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 82.37% | 95.56% |
CHEMBL5163 | Q9NY46 | Sodium channel protein type III alpha subunit | 81.99% | 96.90% |
CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 81.28% | 93.00% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 80.87% | 96.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Ipomoea alba |
PubChem | 71451029 |
LOTUS | LTS0210322 |
wikiData | Q105033725 |