Alantrypinone
Internal ID | 1c0cb66d-ce8e-4e16-98ec-4c40ea0ee51b |
Taxonomy | Organoheterocyclic compounds > Pyridopyrimidines |
IUPAC Name | (1'R,3R,12'R)-12'-methylspiro[1H-indole-3,16'-2,10,13-triazatetracyclo[10.2.2.02,11.04,9]hexadeca-4,6,8,10-tetraene]-2,3',14'-trione |
SMILES (Canonical) | CC12C3=NC4=CC=CC=C4C(=O)N3C(CC15C6=CC=CC=C6NC5=O)C(=O)N2 |
SMILES (Isomeric) | C[C@]12C3=NC4=CC=CC=C4C(=O)N3[C@H](C[C@@]15C6=CC=CC=C6NC5=O)C(=O)N2 |
InChI | InChI=1S/C21H16N4O3/c1-20-18-22-13-8-4-2-6-11(13)17(27)25(18)15(16(26)24-20)10-21(20)12-7-3-5-9-14(12)23-19(21)28/h2-9,15H,10H2,1H3,(H,23,28)(H,24,26)/t15-,20+,21+/m1/s1 |
InChI Key | COXWNIZQNAMTQL-NQERJWCQSA-N |
Popularity | 7 references in papers |
Molecular Formula | C21H16N4O3 |
Molecular Weight | 372.40 g/mol |
Exact Mass | 372.12224039 g/mol |
Topological Polar Surface Area (TPSA) | 90.90 Ų |
XlogP | 0.80 |
212911-06-3 |
DTXSID70891846 |
Q63392384 |
(1'R,3R,12'R)-12'-methylspiro[1H-indole-3,16'-2,10,13-triazatetracyclo[10.2.2.02,11.04,9]hexadeca-4,6,8,10-tetraene]-2,3',14'-trione |
(1'S,3S,12'S)-12'-Methyl-3'H,15'H-spiro[indole-3,13'-[2,10,16]triazatetracyclo[10.2.2.02,11.04,9]hexadeca[4,6,8,10]tetraene]-2,3',15'(1H)-trione |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 96.41% | 99.23% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 95.72% | 95.56% |
CHEMBL2581 | P07339 | Cathepsin D | 94.84% | 98.95% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 93.86% | 96.09% |
CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 93.67% | 94.62% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 93.09% | 85.14% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 91.29% | 86.33% |
CHEMBL5805 | Q9NR97 | Toll-like receptor 8 | 89.64% | 96.25% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 88.79% | 97.09% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 87.72% | 91.11% |
CHEMBL2095172 | P14867 | GABA-A receptor; alpha-1/beta-2/gamma-2 | 87.21% | 92.67% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 84.94% | 94.00% |
CHEMBL2693 | Q9UIQ6 | Cystinyl aminopeptidase | 84.89% | 97.64% |
CHEMBL4208 | P20618 | Proteasome component C5 | 84.19% | 90.00% |
CHEMBL3155 | P34969 | Serotonin 7 (5-HT7) receptor | 83.14% | 90.71% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 83.04% | 94.75% |
CHEMBL2959 | Q08881 | Tyrosine-protein kinase ITK/TSK | 81.83% | 95.00% |
CHEMBL255 | P29275 | Adenosine A2b receptor | 81.68% | 98.59% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Vepris louisii |
PubChem | 10666980 |
LOTUS | LTS0056927 |
wikiData | Q105113101 |