Agsfisnxcbmplz-jmocgyexsa-
Internal ID | b04b026f-1216-4d16-839a-b881c954ad13 |
Taxonomy | Organic oxygen compounds > Organooxygen compounds > Carbohydrates and carbohydrate conjugates > Oligosaccharides |
IUPAC Name | [(2S,3S,4R,5R)-4-hydroxy-2-[[(E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoyl]oxymethyl]-5-(hydroxymethyl)-2-[(2R,3R,4S,5R,6R)-6-(hydroxymethyl)-5-[(E)-3-[3-methoxy-4-[(2S,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyphenyl]prop-2-enoyl]oxy-4-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-[[(E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoyl]oxymethyl]oxan-2-yl]oxy-3-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-2-yl]oxyoxolan-3-yl] benzoate |
SMILES (Canonical) | CC1C(C(C(C(O1)OC2=C(C=C(C=C2)C=CC(=O)OC3C(OC(C(C3OC4C(C(C(C(O4)COC(=O)C=CC5=CC(=C(C=C5)O)OC)O)O)O)OC6C(C(C(C(O6)CO)O)O)O)OC7(C(C(C(O7)CO)O)OC(=O)C8=CC=CC=C8)COC(=O)C=CC9=CC(=C(C=C9)O)OC)CO)OC)O)O)O |
SMILES (Isomeric) | C[C@H]1[C@@H]([C@H]([C@H]([C@@H](O1)OC2=C(C=C(C=C2)/C=C/C(=O)O[C@@H]3[C@H](O[C@@H]([C@@H]([C@H]3O[C@H]4[C@@H]([C@H]([C@@H]([C@H](O4)COC(=O)/C=C/C5=CC(=C(C=C5)O)OC)O)O)O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O)O[C@]7([C@H]([C@@H]([C@H](O7)CO)O)OC(=O)C8=CC=CC=C8)COC(=O)/C=C/C9=CC(=C(C=C9)O)OC)CO)OC)O)O)O |
InChI | InChI=1S/C67H80O35/c1-30-48(76)52(80)55(83)63(92-30)93-37-18-12-33(24-40(37)89-4)15-21-47(75)97-58-43(27-70)95-66(102-67(29-91-46(74)20-14-32-11-17-36(72)39(23-32)88-3)61(51(79)42(26-69)101-67)100-62(86)34-8-6-5-7-9-34)60(99-64-56(84)53(81)49(77)41(25-68)94-64)59(58)98-65-57(85)54(82)50(78)44(96-65)28-90-45(73)19-13-31-10-16-35(71)38(22-31)87-2/h5-24,30,41-44,48-61,63-66,68-72,76-85H,25-29H2,1-4H3/b19-13+,20-14+,21-15+/t30-,41+,42+,43+,44+,48-,49+,50+,51+,52+,53-,54-,55+,56+,57+,58+,59-,60+,61-,63-,64-,65-,66+,67-/m0/s1 |
InChI Key | AGSFISNXCBMPLZ-JMOCGYEXSA-N |
Popularity | 0 references in papers |
Molecular Formula | C67H80O35 |
Molecular Weight | 1445.30 g/mol |
Exact Mass | 1444.4480142 g/mol |
Topological Polar Surface Area (TPSA) | 519.00 Ų |
XlogP | -1.00 |
InChI=1/C67H80O35/c1-30-48(76)52(80)55(83)63(92-30)93-37-18-12-33(24-40(37)89-4)15-21-47(75)97-58-43(27-70)95-66(102-67(29-91-46(74)20-14-32-11-17-36(72)39(23-32)88-3)61(51(79)42(26-69)101-67)100-62(86)34-8-6-5-7-9-34)60(99-64-56(84)53(81)49(77)41(25-68)9 |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL1951 | P21397 | Monoamine oxidase A | 99.70% | 91.49% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 99.51% | 86.33% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.01% | 91.11% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 98.25% | 96.00% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.91% | 96.09% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 95.10% | 89.00% |
CHEMBL3475 | P05121 | Plasminogen activator inhibitor-1 | 92.81% | 83.00% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 92.27% | 95.56% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 91.19% | 99.17% |
CHEMBL3194 | P02766 | Transthyretin | 90.51% | 90.71% |
CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 89.89% | 97.36% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 89.67% | 85.14% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 89.47% | 90.17% |
CHEMBL4208 | P20618 | Proteasome component C5 | 87.52% | 90.00% |
CHEMBL2581 | P07339 | Cathepsin D | 87.30% | 98.95% |
CHEMBL2085 | P14174 | Macrophage migration inhibitory factor | 87.01% | 80.78% |
CHEMBL3401 | O75469 | Pregnane X receptor | 86.99% | 94.73% |
CHEMBL5028 | O14672 | ADAM10 | 86.26% | 97.50% |
CHEMBL3713062 | P10646 | Tissue factor pathway inhibitor | 86.02% | 97.33% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 84.49% | 95.50% |
CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 84.04% | 91.07% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 83.80% | 91.19% |
CHEMBL4829 | O00763 | Acetyl-CoA carboxylase 2 | 82.36% | 98.00% |
CHEMBL2535 | P11166 | Glucose transporter | 82.17% | 98.75% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 81.14% | 97.14% |
CHEMBL3476 | O15111 | Inhibitor of nuclear factor kappa B kinase alpha subunit | 80.72% | 95.83% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 80.65% | 92.50% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Polygala myrtifolia |
PubChem | 10920388 |
LOTUS | LTS0127681 |
wikiData | Q104912001 |