[(1S,3R,18S,24R,26S)-20,22,23,25-tetraacetyloxy-21-(acetyloxymethyl)-26-hydroxy-3,15,26-trimethyl-6,16-dioxo-2,5,17-trioxa-11-azapentacyclo[16.7.1.01,21.03,24.07,12]hexacosa-7(12),8,10-trien-19-yl] benzoate
Internal ID | 467abc7e-a03a-4d33-8607-ae9b347c31bf |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Terpene lactones |
IUPAC Name | [(1S,3R,18S,24R,26S)-20,22,23,25-tetraacetyloxy-21-(acetyloxymethyl)-26-hydroxy-3,15,26-trimethyl-6,16-dioxo-2,5,17-trioxa-11-azapentacyclo[16.7.1.01,21.03,24.07,12]hexacosa-7(12),8,10-trien-19-yl] benzoate |
SMILES (Canonical) | CC1CCC2=C(C=CC=N2)C(=O)OCC3(C4C(C(C5(C(C(C(C(C5(C4OC(=O)C)O3)(C)O)OC1=O)OC(=O)C6=CC=CC=C6)OC(=O)C)COC(=O)C)OC(=O)C)OC(=O)C)C |
SMILES (Isomeric) | CC1CCC2=C(C=CC=N2)C(=O)OC[C@]3([C@@H]4C(C(C5(C(C([C@@H]([C@]([C@]5(C4OC(=O)C)O3)(C)O)OC1=O)OC(=O)C6=CC=CC=C6)OC(=O)C)COC(=O)C)OC(=O)C)OC(=O)C)C |
InChI | InChI=1S/C43H49NO18/c1-21-16-17-29-28(15-12-18-44-29)39(52)55-19-40(7)30-31(56-23(3)46)35(58-25(5)48)42(20-54-22(2)45)36(59-26(6)49)32(60-38(51)27-13-10-9-11-14-27)34(61-37(21)50)41(8,53)43(42,62-40)33(30)57-24(4)47/h9-15,18,21,30-36,53H,16-17,19-20H2,1-8H3/t21?,30-,31?,32?,33?,34+,35?,36?,40+,41+,42?,43+/m1/s1 |
InChI Key | ZOCKGJZEUVPPPI-HWZLBOCFSA-N |
Popularity | 0 references in papers |
Molecular Formula | C43H49NO18 |
Molecular Weight | 867.80 g/mol |
Exact Mass | 867.29496371 g/mol |
Topological Polar Surface Area (TPSA) | 253.00 Ų |
XlogP | 2.20 |
There are no found synonyms. |
![2D Structure of [(1S,3R,18S,24R,26S)-20,22,23,25-tetraacetyloxy-21-(acetyloxymethyl)-26-hydroxy-3,15,26-trimethyl-6,16-dioxo-2,5,17-trioxa-11-azapentacyclo[16.7.1.01,21.03,24.07,12]hexacosa-7(12),8,10-trien-19-yl] benzoate 2D Structure of [(1S,3R,18S,24R,26S)-20,22,23,25-tetraacetyloxy-21-(acetyloxymethyl)-26-hydroxy-3,15,26-trimethyl-6,16-dioxo-2,5,17-trioxa-11-azapentacyclo[16.7.1.01,21.03,24.07,12]hexacosa-7(12),8,10-trien-19-yl] benzoate](https://plantaedb.com/storage/docs/compounds/2023/11/af8ce6e0-8608-11ee-9b38-59e44f624593.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 97.87% | 86.33% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 97.56% | 91.49% |
CHEMBL2581 | P07339 | Cathepsin D | 97.36% | 98.95% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.20% | 96.09% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 97.09% | 85.14% |
CHEMBL1293277 | O15118 | Niemann-Pick C1 protein | 93.82% | 81.11% |
CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 93.64% | 82.69% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 93.56% | 99.23% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 89.46% | 90.17% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 89.22% | 91.11% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 88.63% | 97.25% |
CHEMBL2094127 | P06493 | Cyclin-dependent kinase 1/cyclin B | 88.52% | 96.00% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 88.38% | 95.56% |
CHEMBL335 | P18031 | Protein-tyrosine phosphatase 1B | 88.20% | 95.17% |
CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 87.47% | 93.00% |
CHEMBL3475 | P05121 | Plasminogen activator inhibitor-1 | 86.26% | 83.00% |
CHEMBL5028 | O14672 | ADAM10 | 85.54% | 97.50% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 85.30% | 89.00% |
CHEMBL1293294 | P51151 | Ras-related protein Rab-9A | 84.84% | 87.67% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 83.39% | 94.00% |
CHEMBL2535 | P11166 | Glucose transporter | 82.86% | 98.75% |
CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 82.67% | 94.62% |
CHEMBL2378 | P30307 | Dual specificity phosphatase Cdc25C | 81.98% | 96.67% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 81.55% | 95.89% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 80.62% | 100.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Peritassa campestris |
Peritassa laevigata |
Tripterygium wilfordii |
PubChem | 5315310 |
LOTUS | LTS0172182 |
wikiData | Q105380355 |