2-[2-[8-[4,5-Dihydroxy-6-methyl-3-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-2-yl]oxy-3,7-dimethylocta-2,6-dienoxy]-3,5-dihydroxy-6-methyloxan-4-yl]oxy-6-methyloxane-3,4,5-triol
| Internal ID | eb7c92db-6a4c-4b38-9cb7-aab4b6cd969c |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Terpene glycosides |
| IUPAC Name | 2-[2-[8-[4,5-dihydroxy-6-methyl-3-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-2-yl]oxy-3,7-dimethylocta-2,6-dienoxy]-3,5-dihydroxy-6-methyloxan-4-yl]oxy-6-methyloxane-3,4,5-triol |
| SMILES (Canonical) | CC1C(C(C(C(O1)OC2C(C(OC(C2O)OCC=C(C)CCC=C(C)COC3C(C(C(C(O3)C)O)O)OC4C(C(C(C(O4)CO)O)O)O)C)O)O)O)O |
| SMILES (Isomeric) | CC1C(C(C(C(O1)OC2C(C(OC(C2O)OCC=C(C)CCC=C(C)COC3C(C(C(C(O3)C)O)O)OC4C(C(C(C(O4)CO)O)O)O)C)O)O)O)O |
| InChI | InChI=1S/C34H58O19/c1-13(9-10-46-31-28(45)29(21(38)17(5)48-31)52-32-26(43)23(40)19(36)15(3)49-32)7-6-8-14(2)12-47-34-30(25(42)20(37)16(4)50-34)53-33-27(44)24(41)22(39)18(11-35)51-33/h8-9,15-45H,6-7,10-12H2,1-5H3 |
| InChI Key | HRYZPIZXLPEQGZ-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C34H58O19 |
| Molecular Weight | 770.80 g/mol |
| Exact Mass | 770.35722962 g/mol |
| Topological Polar Surface Area (TPSA) | 296.00 Ų |
| XlogP | -3.20 |
| There are no found synonyms. |
![2D Structure of 2-[2-[8-[4,5-Dihydroxy-6-methyl-3-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-2-yl]oxy-3,7-dimethylocta-2,6-dienoxy]-3,5-dihydroxy-6-methyloxan-4-yl]oxy-6-methyloxane-3,4,5-triol](https://plantaedb.com/storage/docs/compounds/2023/11/aef851c0-85fa-11ee-bb06-83b89f8d27d8.jpg "2D Structure of 2-[2-[8-[4,5-Dihydroxy-6-methyl-3-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-2-yl]oxy-3,7-dimethylocta-2,6-dienoxy]-3,5-dihydroxy-6-methyloxan-4-yl]oxy-6-methyloxane-3,4,5-triol")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.36% | 91.11% |
| CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 92.90% | 97.36% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 91.40% | 96.09% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 90.78% | 94.73% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 89.10% | 86.33% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 87.69% | 99.17% |
| CHEMBL3589 | P55263 | Adenosine kinase | 87.29% | 98.05% |
| CHEMBL4769 | O95749 | Geranylgeranyl pyrophosphate synthetase | 85.68% | 92.08% |
| CHEMBL2581 | P07339 | Cathepsin D | 82.28% | 98.95% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 82.28% | 89.00% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 82.19% | 96.00% |
| CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 82.07% | 86.92% |
| CHEMBL1293255 | P15428 | 15-hydroxyprostaglandin dehydrogenase [NAD+] | 80.75% | 83.57% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Garcinia cowa |
| Garcinia humilis |
| Garcinia oblongifolia |
| Garcinia yunnanensis |
| Vangueria agrestis |
| PubChem | 162962030 |
| LOTUS | LTS0100670 |
| wikiData | Q104400301 |