(4R,4aS,6aS,6aS,6bR,8aS,12aR,14aS,14bS)-4,4a,6a,6b,8a,11,11,14a-octamethyl-1,2,4,5,6,6a,7,8,9,12,12a,13,14,14b-tetradecahydropicene-3,10-dione
Internal ID | dee54f07-5e13-4737-a29b-d0099e563642 |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Triterpenoids |
IUPAC Name | (4R,4aS,6aS,6aS,6bR,8aS,12aR,14aS,14bS)-4,4a,6a,6b,8a,11,11,14a-octamethyl-1,2,4,5,6,6a,7,8,9,12,12a,13,14,14b-tetradecahydropicene-3,10-dione |
SMILES (Canonical) | CC1C(=O)CCC2C1(CCC3C2(CCC4(C3(CCC5(C4CC(C(=O)C5)(C)C)C)C)C)C)C |
SMILES (Isomeric) | C[C@H]1C(=O)CC[C@@H]2[C@@]1(CC[C@H]3[C@]2(CC[C@@]4([C@@]3(CC[C@@]5([C@H]4CC(C(=O)C5)(C)C)C)C)C)C)C |
InChI | InChI=1S/C30H48O2/c1-19-20(31)9-10-21-27(19,5)12-11-22-28(21,6)14-16-30(8)23-17-25(2,3)24(32)18-26(23,4)13-15-29(22,30)7/h19,21-23H,9-18H2,1-8H3/t19-,21+,22-,23+,26-,27+,28-,29+,30-/m0/s1 |
InChI Key | CHJYPPKATUUBNB-ZFKGVFHZSA-N |
Popularity | 0 references in papers |
Molecular Formula | C30H48O2 |
Molecular Weight | 440.70 g/mol |
Exact Mass | 440.365430770 g/mol |
Topological Polar Surface Area (TPSA) | 34.10 Ų |
XlogP | 8.00 |
There are no found synonyms. |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 95.12% | 82.69% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 93.54% | 94.75% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 92.77% | 97.25% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 89.67% | 92.94% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 88.25% | 97.09% |
CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 87.99% | 96.38% |
CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 85.96% | 93.03% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 85.48% | 95.56% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 85.31% | 100.00% |
CHEMBL3524 | P56524 | Histone deacetylase 4 | 85.01% | 92.97% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 84.88% | 91.11% |
CHEMBL2581 | P07339 | Cathepsin D | 84.14% | 98.95% |
CHEMBL3351 | Q13085 | Acetyl-CoA carboxylase 1 | 83.78% | 93.04% |
CHEMBL2916 | O14746 | Telomerase reverse transcriptase | 83.24% | 90.00% |
CHEMBL1902 | P62942 | FK506-binding protein 1A | 82.74% | 97.05% |
CHEMBL204 | P00734 | Thrombin | 82.11% | 96.01% |
CHEMBL1871 | P10275 | Androgen Receptor | 80.82% | 96.43% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 80.33% | 99.23% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Kokoona zeylanica |
PubChem | 14466312 |
LOTUS | LTS0053586 |
wikiData | Q104958923 |