Adenosine Phosphate
Internal ID | 85b57971-0dcd-4f78-ad31-b185da0854f4 |
Taxonomy | Nucleosides, nucleotides, and analogues > Purine nucleotides > Purine ribonucleotides > Purine ribonucleoside monophosphates |
IUPAC Name | [(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl dihydrogen phosphate |
SMILES (Canonical) | C1=NC(=C2C(=N1)N(C=N2)C3C(C(C(O3)COP(=O)(O)O)O)O)N |
SMILES (Isomeric) | C1=NC(=C2C(=N1)N(C=N2)[C@H]3[C@@H]([C@@H]([C@H](O3)COP(=O)(O)O)O)O)N |
InChI | InChI=1S/C10H14N5O7P/c11-8-5-9(13-2-12-8)15(3-14-5)10-7(17)6(16)4(22-10)1-21-23(18,19)20/h2-4,6-7,10,16-17H,1H2,(H2,11,12,13)(H2,18,19,20)/t4-,6-,7-,10-/m1/s1 |
InChI Key | UDMBCSSLTHHNCD-KQYNXXCUSA-N |
Popularity | 39,412 references in papers |
Molecular Formula | C10H14N5O7P |
Molecular Weight | 347.22 g/mol |
Exact Mass | 347.06308480 g/mol |
Topological Polar Surface Area (TPSA) | 186.00 Ų |
XlogP | -3.50 |
Atomic LogP (AlogP) | -1.86 |
H-Bond Acceptor | 10 |
H-Bond Donor | 5 |
Rotatable Bonds | 4 |
5'-adenylic acid |
adenosine phosphate |
Adenosine monophosphate |
61-19-8 |
adenylic acid |
adenosine 5'-phosphate |
5'-AMP |
adenylate |
Phosphentaside |
Adenovite |
There are more than 10 synonyms. If you wish to see them all click here. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
Human Intestinal Absorption | - | 0.4885 | 48.85% |
Caco-2 | - | 0.9203 | 92.03% |
Blood Brain Barrier | + | 0.7000 | 70.00% |
Human oral bioavailability | - | 0.7143 | 71.43% |
Subcellular localzation | Mitochondria | 0.4045 | 40.45% |
OATP2B1 inhibitior | - | 1.0000 | 100.00% |
OATP1B1 inhibitior | + | 0.9575 | 95.75% |
OATP1B3 inhibitior | + | 0.9479 | 94.79% |
MATE1 inhibitior | - | 0.9600 | 96.00% |
OCT2 inhibitior | - | 0.9750 | 97.50% |
BSEP inhibitior | - | 0.9164 | 91.64% |
P-glycoprotein inhibitior | - | 0.8621 | 86.21% |
P-glycoprotein substrate | - | 0.8584 | 85.84% |
CYP3A4 substrate | - | 0.5092 | 50.92% |
CYP2C9 substrate | - | 1.0000 | 100.00% |
CYP2D6 substrate | - | 0.8648 | 86.48% |
CYP3A4 inhibition | - | 0.9296 | 92.96% |
CYP2C9 inhibition | - | 0.9419 | 94.19% |
CYP2C19 inhibition | - | 0.9293 | 92.93% |
CYP2D6 inhibition | - | 0.9210 | 92.10% |
CYP1A2 inhibition | - | 0.9078 | 90.78% |
CYP2C8 inhibition | - | 0.8010 | 80.10% |
CYP inhibitory promiscuity | - | 0.9633 | 96.33% |
UGT catelyzed | - | 0.7000 | 70.00% |
Carcinogenicity (binary) | - | 0.9500 | 95.00% |
Carcinogenicity (trinary) | Non-required | 0.5557 | 55.57% |
Eye corrosion | - | 0.9877 | 98.77% |
Eye irritation | - | 0.9610 | 96.10% |
Skin irritation | - | 0.7589 | 75.89% |
Skin corrosion | - | 0.9254 | 92.54% |
Ames mutagenesis | - | 0.8200 | 82.00% |
Human Ether-a-go-go-Related Gene inhibition | - | 0.7483 | 74.83% |
Micronuclear | + | 1.0000 | 100.00% |
Hepatotoxicity | - | 0.5486 | 54.86% |
skin sensitisation | - | 0.8414 | 84.14% |
Respiratory toxicity | + | 0.9556 | 95.56% |
Reproductive toxicity | + | 0.9556 | 95.56% |
Mitochondrial toxicity | + | 1.0000 | 100.00% |
Nephrotoxicity | - | 0.8449 | 84.49% |
Acute Oral Toxicity (c) | III | 0.4907 | 49.07% |
Estrogen receptor binding | + | 0.5944 | 59.44% |
Androgen receptor binding | + | 0.5601 | 56.01% |
Thyroid receptor binding | + | 0.6201 | 62.01% |
Glucocorticoid receptor binding | - | 0.4750 | 47.50% |
Aromatase binding | + | 0.8403 | 84.03% |
PPAR gamma | + | 0.5543 | 55.43% |
Honey bee toxicity | - | 0.7807 | 78.07% |
Biodegradation | - | 0.8000 | 80.00% |
Crustacea aquatic toxicity | - | 0.6100 | 61.00% |
Fish aquatic toxicity | - | 0.6308 | 63.08% |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
CHEMBL226 | P30542 | Adenosine A1 receptor |
500 nM 500 nM |
EC50 EC50 |
PMID: 22738238
via Super-PRED |
CHEMBL3975 | P09467 | Fructose-1,6-bisphosphatase |
800 nM 1000 nM 440 nM 140 nM 1000 nM 140 nM |
IC50 IC50 IC50 IC50 IC50 IC50 |
PMID: 11140724
PMID: 19348494 PMID: 19969452 PMID: 19969452 DOI: 10.1039/C0MD00269K via Super-PRED |
CHEMBL4315 | P47900 | Purinergic receptor P2Y1 |
1500 nM 7200 nM |
EC50 EC50 |
PMID: 11754592
PMID: 11754592 |
CHEMBL4398 | P41231 | Purinergic receptor P2Y2 |
85 nM 3700 nM |
EC50 EC50 |
PMID: 11754592
PMID: 11754592 |
CHEMBL1293232 | Q16637 | Survival motor neuron protein |
31622.8 nM |
Potency |
via CMAUP
|
CHEMBL267 | P12931 | Tyrosine-protein kinase SRC |
100 nM |
IC50 |
PMID: 1479375
|
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.49% | 96.09% |
CHEMBL1075162 | Q13304 | Uracil nucleotide/cysteinyl leukotriene receptor | 97.75% | 80.33% |
CHEMBL3137261 | O14744 | PRMT5/MEP50 complex | 94.42% | 100.00% |
CHEMBL3401 | O75469 | Pregnane X receptor | 91.27% | 94.73% |
CHEMBL3230 | O95977 | Sphingosine 1-phosphate receptor Edg-6 | 88.62% | 94.01% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 86.15% | 94.00% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 84.47% | 95.89% |
CHEMBL4523377 | Q86WV6 | Stimulator of interferon genes protein | 83.05% | 95.48% |
CHEMBL5957 | P21589 | 5'-nucleotidase | 82.96% | 97.78% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 82.13% | 91.11% |
CHEMBL5524 | Q99873 | Protein-arginine N-methyltransferase 1 | 82.03% | 96.67% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 81.75% | 89.00% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 81.55% | 99.23% |
CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 81.16% | 100.00% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 80.34% | 99.17% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Arabidopsis thaliana |
Helianthus tuberosus |
Isodon rubescens |
Populus tremula |