(2R,3R,4S,5S,6R)-2-[(2S)-4-[(1R,2S,4S,6S,7S,8R,9S,12S,13S,16S,18R)-16-[(2R,3R,4S,5R,6R)-4,5-dihydroxy-6-(hydroxymethyl)-3-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-2-yl]oxy-6-methoxy-7,9,13-trimethyl-5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icosan-6-yl]-2-methylbutoxy]-6-(hydroxymethyl)oxane-3,4,5-triol
Internal ID | 897a7c6b-26c3-4695-9161-d5455d737707 |
Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Steroidal glycosides > Steroidal saponins |
IUPAC Name | (2R,3R,4S,5S,6R)-2-[(2S)-4-[(1R,2S,4S,6S,7S,8R,9S,12S,13S,16S,18R)-16-[(2R,3R,4S,5R,6R)-4,5-dihydroxy-6-(hydroxymethyl)-3-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-2-yl]oxy-6-methoxy-7,9,13-trimethyl-5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icosan-6-yl]-2-methylbutoxy]-6-(hydroxymethyl)oxane-3,4,5-triol |
SMILES (Canonical) | CC1C2C(CC3C2(CCC4C3CCC5C4(CCC(C5)OC6C(C(C(C(O6)CO)O)O)OC7C(C(C(C(O7)CO)O)O)O)C)C)OC1(CCC(C)COC8C(C(C(C(O8)CO)O)O)O)OC |
SMILES (Isomeric) | C[C@H]1[C@H]2[C@H](C[C@@H]3[C@@]2(CC[C@H]4[C@H]3CC[C@H]5[C@@]4(CC[C@@H](C5)O[C@H]6[C@@H]([C@H]([C@H]([C@H](O6)CO)O)O)O[C@H]7[C@@H]([C@H]([C@@H]([C@H](O7)CO)O)O)O)C)C)O[C@]1(CC[C@H](C)CO[C@H]8[C@@H]([C@H]([C@@H]([C@H](O8)CO)O)O)O)OC |
InChI | InChI=1S/C46H78O19/c1-20(19-59-41-38(56)35(53)32(50)28(16-47)61-41)8-13-46(58-5)21(2)31-27(65-46)15-26-24-7-6-22-14-23(9-11-44(22,3)25(24)10-12-45(26,31)4)60-43-40(37(55)34(52)30(18-49)63-43)64-42-39(57)36(54)33(51)29(17-48)62-42/h20-43,47-57H,6-19H2,1-5H3/t20-,21-,22+,23-,24+,25-,26-,27-,28+,29+,30+,31-,32+,33+,34-,35-,36-,37-,38+,39+,40+,41+,42-,43+,44-,45-,46-/m0/s1 |
InChI Key | FDASUPFDHLZNSK-MDNZVZNASA-N |
Popularity | 0 references in papers |
Molecular Formula | C46H78O19 |
Molecular Weight | 935.10 g/mol |
Exact Mass | 934.51373025 g/mol |
Topological Polar Surface Area (TPSA) | 296.00 Ų |
XlogP | 1.30 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.54% | 96.09% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.99% | 91.11% |
CHEMBL237 | P41145 | Kappa opioid receptor | 94.79% | 98.10% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 94.33% | 97.09% |
CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 93.95% | 96.21% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 93.28% | 94.45% |
CHEMBL2094135 | Q96BI3 | Gamma-secretase | 92.34% | 98.05% |
CHEMBL2955 | O95136 | Sphingosine 1-phosphate receptor Edg-5 | 92.14% | 92.86% |
CHEMBL233 | P35372 | Mu opioid receptor | 91.96% | 97.93% |
CHEMBL4681 | P42330 | Aldo-keto-reductase family 1 member C3 | 91.21% | 89.05% |
CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 91.16% | 96.61% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 90.95% | 97.25% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 89.51% | 100.00% |
CHEMBL4581 | P52732 | Kinesin-like protein 1 | 89.44% | 93.18% |
CHEMBL2534 | O15530 | 3-phosphoinositide dependent protein kinase-1 | 89.38% | 95.36% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 88.81% | 95.93% |
CHEMBL2996 | Q05655 | Protein kinase C delta | 87.81% | 97.79% |
CHEMBL2730 | P21980 | Protein-glutamine gamma-glutamyltransferase | 87.35% | 92.38% |
CHEMBL6136 | O60341 | Lysine-specific histone demethylase 1 | 87.02% | 95.58% |
CHEMBL4302 | P08183 | P-glycoprotein 1 | 86.66% | 92.98% |
CHEMBL220 | P22303 | Acetylcholinesterase | 86.36% | 94.45% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 85.00% | 95.89% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 84.99% | 95.89% |
CHEMBL206 | P03372 | Estrogen receptor alpha | 84.78% | 97.64% |
CHEMBL2140 | P48775 | Tryptophan 2,3-dioxygenase | 84.71% | 98.46% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 84.56% | 92.94% |
CHEMBL1871 | P10275 | Androgen Receptor | 83.58% | 96.43% |
CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 83.38% | 96.47% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 83.14% | 92.50% |
CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 83.08% | 100.00% |
CHEMBL204 | P00734 | Thrombin | 82.93% | 96.01% |
CHEMBL3892 | Q99500 | Sphingosine 1-phosphate receptor Edg-3 | 82.65% | 97.29% |
CHEMBL4618 | P09960 | Leukotriene A4 hydrolase | 82.27% | 97.86% |
CHEMBL3430907 | Q96GD4 | Aurora kinase B/Inner centromere protein | 82.23% | 97.50% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 81.96% | 100.00% |
CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 81.46% | 95.50% |
CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 80.76% | 93.56% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Anemarrhena asphodeloides |
PubChem | 124864709 |
LOTUS | LTS0161444 |
wikiData | Q104993483 |