10-[3-[3,5-Dihydroxy-6-methyl-4-(3,4,5-trihydroxy-6-methyloxan-2-yl)oxyoxan-2-yl]oxy-5-hydroxy-4-[2,3,4-trihydroxy-5-(hydroxymethyl)cyclohexyl]oxyoxan-2-yl]oxy-6a,6b,9,9,12a-pentamethyl-2-methylidene-1,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydropicene-4a-carboxylic acid
Internal ID | 26efd348-8ffe-4ae5-afb3-87b88921f292 |
Taxonomy | Organic oxygen compounds > Organooxygen compounds > Carbohydrates and carbohydrate conjugates > Oligosaccharides |
IUPAC Name | 10-[3-[3,5-dihydroxy-6-methyl-4-(3,4,5-trihydroxy-6-methyloxan-2-yl)oxyoxan-2-yl]oxy-5-hydroxy-4-[2,3,4-trihydroxy-5-(hydroxymethyl)cyclohexyl]oxyoxan-2-yl]oxy-6a,6b,9,9,12a-pentamethyl-2-methylidene-1,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydropicene-4a-carboxylic acid |
SMILES (Canonical) | CC1C(C(C(C(O1)OC2C(C(OC(C2O)OC3C(C(COC3OC4CCC5(C(C4(C)C)CCC6(C5CC=C7C6(CCC8(C7CC(=C)CC8)C(=O)O)C)C)C)O)OC9CC(C(C(C9O)O)O)CO)C)O)O)O)O |
SMILES (Isomeric) | CC1C(C(C(C(O1)OC2C(C(OC(C2O)OC3C(C(COC3OC4CCC5(C(C4(C)C)CCC6(C5CC=C7C6(CCC8(C7CC(=C)CC8)C(=O)O)C)C)C)O)OC9CC(C(C(C9O)O)O)CO)C)O)O)O)O |
InChI | InChI=1S/C53H84O19/c1-23-11-16-53(48(64)65)18-17-51(7)27(28(53)19-23)9-10-32-50(6)14-13-33(49(4,5)31(50)12-15-52(32,51)8)70-47-44(42(29(55)22-66-47)69-30-20-26(21-54)36(58)39(61)37(30)59)72-46-41(63)43(35(57)25(3)68-46)71-45-40(62)38(60)34(56)24(2)67-45/h9,24-26,28-47,54-63H,1,10-22H2,2-8H3,(H,64,65) |
InChI Key | CTAXKXXRTUTPCW-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C53H84O19 |
Molecular Weight | 1025.20 g/mol |
Exact Mass | 1024.56068045 g/mol |
Topological Polar Surface Area (TPSA) | 304.00 Ų |
XlogP | 1.50 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.77% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.21% | 96.09% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 94.54% | 86.33% |
CHEMBL2581 | P07339 | Cathepsin D | 93.76% | 98.95% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 91.58% | 97.09% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 91.46% | 90.17% |
CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 91.15% | 97.36% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 89.75% | 95.56% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 89.68% | 94.45% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 89.13% | 90.71% |
CHEMBL335 | P18031 | Protein-tyrosine phosphatase 1B | 88.24% | 95.17% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 87.47% | 95.89% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 86.67% | 89.00% |
CHEMBL5028 | O14672 | ADAM10 | 85.69% | 97.50% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 85.59% | 92.94% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 81.74% | 91.19% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 81.22% | 100.00% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 80.98% | 99.17% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Guaiacum officinale |
PubChem | 163045417 |
LOTUS | LTS0102076 |
wikiData | Q104969684 |