[(1R,3R,8S,9S,10R,13S,14S,16S,17R)-17-acetyl-1-[(2S,3R,4S,5S)-4,5-dihydroxy-3-[(2S,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyoxan-2-yl]oxy-3-hydroxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-16-yl] 4-[[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxymethyl]pent-4-enoate
| Internal ID | 214475ca-b047-4c64-9add-b944becbedc5 |
| Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Steroidal glycosides > Steroidal saponins |
| IUPAC Name | [(1R,3R,8S,9S,10R,13S,14S,16S,17R)-17-acetyl-1-[(2S,3R,4S,5S)-4,5-dihydroxy-3-[(2S,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyoxan-2-yl]oxy-3-hydroxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-16-yl] 4-[[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxymethyl]pent-4-enoate |
| SMILES (Canonical) | CC1C(C(C(C(O1)OC2C(C(COC2OC3CC(CC4=CCC5C(C34C)CCC6(C5CC(C6C(=O)C)OC(=O)CCC(=C)COC7C(C(C(C(O7)CO)O)O)O)C)O)O)O)O)O)O |
| SMILES (Isomeric) | C[C@H]1[C@@H]([C@H]([C@H]([C@@H](O1)O[C@@H]2[C@H]([C@H](CO[C@H]2O[C@@H]3C[C@@H](CC4=CC[C@@H]5[C@@H]([C@@]34C)CC[C@]6([C@H]5C[C@@H]([C@@H]6C(=O)C)OC(=O)CCC(=C)CO[C@H]7[C@@H]([C@H]([C@@H]([C@H](O7)CO)O)O)O)C)O)O)O)O)O)O |
| InChI | InChI=1S/C44H68O19/c1-18(16-57-40-37(55)36(54)34(52)28(15-45)61-40)6-9-30(49)60-27-14-25-23-8-7-21-12-22(47)13-29(44(21,5)24(23)10-11-43(25,4)31(27)19(2)46)62-42-39(33(51)26(48)17-58-42)63-41-38(56)35(53)32(50)20(3)59-41/h7,20,22-29,31-42,45,47-48,50-56H,1,6,8-17H2,2-5H3/t20-,22+,23+,24-,25-,26-,27-,28+,29+,31-,32-,33-,34+,35+,36-,37+,38+,39+,40+,41-,42-,43-,44-/m0/s1 |
| InChI Key | VJONGHKCIXZWJG-RHEGOXSLSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C44H68O19 |
| Molecular Weight | 901.00 g/mol |
| Exact Mass | 900.43547994 g/mol |
| Topological Polar Surface Area (TPSA) | 301.00 Ų |
| XlogP | -1.30 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.15% | 91.11% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.51% | 96.09% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 94.47% | 86.33% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 92.61% | 89.00% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 91.82% | 100.00% |
| CHEMBL226 | P30542 | Adenosine A1 receptor | 91.54% | 95.93% |
| CHEMBL5255 | O00206 | Toll-like receptor 4 | 90.57% | 92.50% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 90.53% | 97.09% |
| CHEMBL2581 | P07339 | Cathepsin D | 90.02% | 98.95% |
| CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 89.68% | 95.89% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 88.80% | 94.45% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 86.11% | 91.19% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 85.67% | 90.17% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 85.47% | 96.00% |
| CHEMBL5028 | O14672 | ADAM10 | 84.62% | 97.50% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 84.53% | 99.17% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 84.13% | 94.00% |
| CHEMBL1907602 | P06493 | Cyclin-dependent kinase 1/cyclin B1 | 84.05% | 91.24% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 82.83% | 97.25% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Dracaena angustifolia |
| PubChem | 11115635 |
| LOTUS | LTS0065531 |
| wikiData | Q105287404 |