Acutanguloside F methyl ester
Internal ID | 4e7a15b3-fe79-4b8b-abc0-317c14a04796 |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Terpene glycosides > Triterpene glycosides > Triterpene saponins |
IUPAC Name | methyl (2S,3S,4S,5R,6R)-6-[[(3S,4aR,6aR,6bS,8R,8aR,9R,10R,12aS,14aR,14bR)-8-hydroxy-8a-(hydroxymethyl)-4,4,6a,6b,11,11,14b-heptamethyl-9,10-bis[[(Z)-2-methylbut-2-enoyl]oxy]-1,2,3,4a,5,6,7,8,9,10,12,12a,14,14a-tetradecahydropicen-3-yl]oxy]-3-hydroxy-5-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-4-[(2S,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]oxyoxane-2-carboxylate |
SMILES (Canonical) | CC=C(C)C(=O)OC1C(C2(C(CC1(C)C)C3=CCC4C5(CCC(C(C5CCC4(C3(CC2O)C)C)(C)C)OC6C(C(C(C(O6)C(=O)OC)O)OC7C(C(C(CO7)O)O)O)OC8C(C(C(C(O8)CO)O)O)O)C)CO)OC(=O)C(=CC)C |
SMILES (Isomeric) | C/C=C(/C)\C(=O)O[C@H]1[C@@H](C(C[C@@H]2[C@]1([C@@H](C[C@@]3(C2=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)C(=O)OC)O)O[C@H]7[C@@H]([C@H]([C@@H](CO7)O)O)O)O[C@H]8[C@@H]([C@H]([C@@H]([C@H](O8)CO)O)O)O)C)C)C)O)CO)(C)C)OC(=O)/C(=C\C)/C |
InChI | InChI=1S/C58H90O22/c1-13-26(3)47(69)79-45-46(80-48(70)27(4)14-2)58(25-60)29(21-53(45,5)6)28-15-16-33-55(9)19-18-35(54(7,8)32(55)17-20-56(33,10)57(28,11)22-34(58)62)75-52-44(78-51-40(67)38(65)37(64)31(23-59)74-51)42(41(68)43(77-52)49(71)72-12)76-50-39(66)36(63)30(61)24-73-50/h13-15,29-46,50-52,59-68H,16-25H2,1-12H3/b26-13-,27-14-/t29-,30+,31+,32-,33+,34+,35-,36-,37+,38-,39+,40+,41-,42-,43-,44+,45-,46-,50-,51-,52+,55-,56+,57+,58-/m0/s1 |
InChI Key | HQRCIZLNVNAKMY-SJAHPVODSA-N |
Popularity | 0 references in papers |
Molecular Formula | C58H90O22 |
Molecular Weight | 1139.30 g/mol |
Exact Mass | 1138.59237449 g/mol |
Topological Polar Surface Area (TPSA) | 337.00 Ų |
XlogP | 4.00 |
(-)-Acutanguloside F methyl ester |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.21% | 91.11% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 96.76% | 94.45% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.65% | 96.09% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 90.03% | 94.75% |
CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 89.80% | 94.33% |
CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 89.65% | 91.07% |
CHEMBL2563 | Q9UQL6 | Histone deacetylase 5 | 89.31% | 89.67% |
CHEMBL1907602 | P06493 | Cyclin-dependent kinase 1/cyclin B1 | 89.10% | 91.24% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 87.47% | 90.17% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 86.91% | 95.56% |
CHEMBL2581 | P07339 | Cathepsin D | 86.87% | 98.95% |
CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 86.56% | 95.50% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 85.73% | 95.89% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 85.59% | 86.33% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 85.55% | 99.17% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 85.32% | 100.00% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 85.22% | 97.09% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 83.78% | 95.50% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 82.85% | 92.50% |
CHEMBL2782 | P35610 | Acyl coenzyme A:cholesterol acyltransferase 1 | 82.47% | 91.65% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 82.12% | 92.62% |
CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 81.89% | 96.77% |
CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 81.72% | 93.00% |
CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 80.89% | 96.21% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 80.65% | 94.00% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 80.61% | 97.14% |
CHEMBL3401 | O75469 | Pregnane X receptor | 80.57% | 94.73% |
CHEMBL2716 | Q8WUI4 | Histone deacetylase 7 | 80.34% | 89.44% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Barringtonia acutangula |
PubChem | 162936993 |
LOTUS | LTS0177691 |
wikiData | Q105032397 |