Acetamide, N-(4-(1-(3-methyl-2-butenyl)guanidino)butyl)-
| Internal ID | 914c9232-a43a-43f4-8f50-a319e4095406 |
| Taxonomy | Organic acids and derivatives > Carboxylic acids and derivatives > Carboxylic acid derivatives > Carboxylic acid amides > Acetamides |
| IUPAC Name | N-[4-[[N'-(3-methylbut-2-enyl)carbamimidoyl]amino]butyl]acetamide |
| SMILES (Canonical) | CC(=CCN=C(N)NCCCCNC(=O)C)C |
| SMILES (Isomeric) | CC(=CCN=C(N)NCCCCNC(=O)C)C |
| InChI | InChI=1S/C12H24N4O/c1-10(2)6-9-16-12(13)15-8-5-4-7-14-11(3)17/h6H,4-5,7-9H2,1-3H3,(H,14,17)(H3,13,15,16) |
| InChI Key | ZJPBVAFZWDAVPW-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C12H24N4O |
| Molecular Weight | 240.35 g/mol |
| Exact Mass | 240.19501140 g/mol |
| Topological Polar Surface Area (TPSA) | 79.50 Ų |
| XlogP | 0.80 |
| 27586-69-2 |
| Smirnovine |
| Smyrnovine |
| Acetylisoamylenylputrescin |
| BRN 1795878 |
| N-(4-(1-(3-Methyl-2-butenyl)guanidino)butyl)acetamide |
| 4-04-00-01296 (Beilstein Handbook Reference) |
| DTXSID20181986 |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.73% | 91.11% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 93.44% | 96.09% |
| CHEMBL2581 | P07339 | Cathepsin D | 90.27% | 98.95% |
| CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 88.93% | 96.95% |
| CHEMBL255 | P29275 | Adenosine A2b receptor | 88.89% | 98.59% |
| CHEMBL1293267 | Q9HC97 | G-protein coupled receptor 35 | 88.11% | 89.34% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 87.85% | 99.17% |
| CHEMBL3959 | P16083 | Quinone reductase 2 | 86.54% | 89.49% |
| CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 84.98% | 94.33% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 84.84% | 94.45% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 84.58% | 94.73% |
| CHEMBL3892 | Q99500 | Sphingosine 1-phosphate receptor Edg-3 | 83.77% | 97.29% |
| CHEMBL3830 | Q2M2I8 | Adaptor-associated kinase | 83.72% | 83.10% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 83.41% | 100.00% |
| CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 83.29% | 97.21% |
| CHEMBL6136 | O60341 | Lysine-specific histone demethylase 1 | 82.38% | 95.58% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Galega orientalis |
| PubChem | 33953 |
| LOTUS | LTS0199102 |
| wikiData | Q83052640 |