(1R,2S,3'R,4S,5'S,6R,7S,8R,9S,12S,13S,16S,18S)-5'-hydroxy-16-[(2R,3R,4S,5S,6R)-4-hydroxy-6-(hydroxymethyl)-3,5-bis[[(2S,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxy]oxan-2-yl]oxy-3',7,9,13-tetramethylspiro[5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icosane-6,6'-oxane]-2'-one
Internal ID | daa460fa-f4f8-4f57-9967-f15d21427388 |
Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Steroidal glycosides > Steroidal saponins |
IUPAC Name | (1R,2S,3'R,4S,5'S,6R,7S,8R,9S,12S,13S,16S,18S)-5'-hydroxy-16-[(2R,3R,4S,5S,6R)-4-hydroxy-6-(hydroxymethyl)-3,5-bis[[(2S,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxy]oxan-2-yl]oxy-3',7,9,13-tetramethylspiro[5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icosane-6,6'-oxane]-2'-one |
SMILES (Canonical) | CC1CC(C2(C(C3C(O2)CC4C3(CCC5C4CCC6C5(CCC(C6)OC7C(C(C(C(O7)CO)OC8C(C(C(C(O8)C)O)O)O)O)OC9C(C(C(C(O9)C)O)O)O)C)C)C)OC1=O)O |
SMILES (Isomeric) | C[C@@H]1C[C@@H]([C@@]2([C@H]([C@H]3[C@@H](O2)C[C@@H]4[C@@]3(CC[C@H]5[C@H]4CC[C@@H]6[C@@]5(CC[C@@H](C6)O[C@H]7[C@@H]([C@H]([C@@H]([C@H](O7)CO)O[C@H]8[C@@H]([C@@H]([C@H]([C@@H](O8)C)O)O)O)O)O[C@H]9[C@@H]([C@@H]([C@H]([C@@H](O9)C)O)O)O)C)C)C)OC1=O)O |
InChI | InChI=1S/C45H72O18/c1-17-13-28(47)45(63-39(17)55)18(2)29-26(62-45)15-25-23-8-7-21-14-22(9-11-43(21,5)24(23)10-12-44(25,29)6)58-42-38(61-41-35(53)33(51)31(49)20(4)57-41)36(54)37(27(16-46)59-42)60-40-34(52)32(50)30(48)19(3)56-40/h17-38,40-42,46-54H,7-16H2,1-6H3/t17-,18+,19+,20+,21+,22+,23-,24+,25+,26+,27-,28+,29+,30+,31+,32-,33-,34-,35-,36+,37-,38-,40+,41+,42-,43+,44+,45-/m1/s1 |
InChI Key | VLSICJHWFMNVSZ-FDEJVROYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C45H72O18 |
Molecular Weight | 901.00 g/mol |
Exact Mass | 900.47186544 g/mol |
Topological Polar Surface Area (TPSA) | 273.00 Ų |
XlogP | 0.90 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.61% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.59% | 96.09% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 93.21% | 97.09% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 91.57% | 100.00% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 90.57% | 89.00% |
CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 90.04% | 96.77% |
CHEMBL1871 | P10275 | Androgen Receptor | 88.26% | 96.43% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 87.93% | 94.45% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 86.20% | 95.89% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 86.15% | 94.00% |
CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 85.99% | 96.61% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 85.91% | 97.25% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 84.78% | 92.50% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 84.21% | 92.94% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 83.91% | 95.89% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 83.70% | 94.75% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 83.69% | 95.56% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 82.94% | 86.33% |
CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 82.78% | 96.21% |
CHEMBL3430907 | Q96GD4 | Aurora kinase B/Inner centromere protein | 81.95% | 97.50% |
CHEMBL2140 | P48775 | Tryptophan 2,3-dioxygenase | 80.98% | 98.46% |
CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 80.94% | 97.36% |
CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 80.36% | 100.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Solanum dulcamara |
PubChem | 101604425 |
LOTUS | LTS0252943 |
wikiData | Q105288643 |