(2R,3R,4S,5S,6R)-2-[(2S)-4-[(1R,2S,4S,6R,7S,8R,9S,12S,13S,16S,18R)-16-[(2R,3R,4R,5S,6R)-5-[(2S,3R,4R,5S,6R)-3,4-dihydroxy-5-[(2S,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-6-[[(2S,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]oxymethyl]oxan-2-yl]oxy-3,4-dihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-6-hydroxy-7,9,13-trimethyl-5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icosan-6-yl]-2-methylbutoxy]-6-(hydroxymethyl)oxane-3,4,5-triol
| Internal ID | 61982908-6cff-494c-b59c-bd43aff03f61 |
| Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Steroidal glycosides > Steroidal saponins |
| IUPAC Name | (2R,3R,4S,5S,6R)-2-[(2S)-4-[(1R,2S,4S,6R,7S,8R,9S,12S,13S,16S,18R)-16-[(2R,3R,4R,5S,6R)-5-[(2S,3R,4R,5S,6R)-3,4-dihydroxy-5-[(2S,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-6-[[(2S,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]oxymethyl]oxan-2-yl]oxy-3,4-dihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-6-hydroxy-7,9,13-trimethyl-5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icosan-6-yl]-2-methylbutoxy]-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES (Canonical) | CC1C2C(CC3C2(CCC4C3CCC5C4(CCC(C5)OC6C(C(C(C(O6)CO)OC7C(C(C(C(O7)COC8C(C(C(CO8)O)O)O)OC9C(C(C(C(O9)CO)O)O)O)O)O)O)O)C)C)OC1(CCC(C)COC1C(C(C(C(O1)CO)O)O)O)O |
| SMILES (Isomeric) | C[C@H]1[C@H]2[C@H](C[C@@H]3[C@@]2(CC[C@H]4[C@H]3CC[C@H]5[C@@]4(CC[C@@H](C5)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O[C@H]7[C@@H]([C@H]([C@@H]([C@H](O7)CO[C@H]8[C@@H]([C@H]([C@@H](CO8)O)O)O)O[C@H]9[C@@H]([C@H]([C@H]([C@H](O9)CO)O)O)O)O)O)O)O)C)C)O[C@@]1(CC[C@H](C)CO[C@H]1[C@@H]([C@H]([C@@H]([C@H](O1)CO)O)O)O)O |
| InChI | InChI=1S/C56H94O28/c1-21(18-74-50-43(69)38(64)36(62)30(15-57)78-50)7-12-56(73)22(2)34-29(84-56)14-27-25-6-5-23-13-24(8-10-54(23,3)26(25)9-11-55(27,34)4)77-51-45(71)40(66)47(32(17-59)80-51)82-53-46(72)41(67)48(83-52-44(70)39(65)37(63)31(16-58)79-52)33(81-53)20-76-49-42(68)35(61)28(60)19-75-49/h21-53,57-73H,5-20H2,1-4H3/t21-,22-,23+,24-,25+,26-,27-,28+,29-,30+,31+,32+,33+,34-,35-,36+,37-,38-,39-,40+,41+,42+,43+,44+,45+,46+,47+,48+,49-,50+,51+,52-,53-,54-,55-,56+/m0/s1 |
| InChI Key | JTPYBOVDHKSQLC-LWJJEENESA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C56H94O28 |
| Molecular Weight | 1215.30 g/mol |
| Exact Mass | 1214.59316234 g/mol |
| Topological Polar Surface Area (TPSA) | 445.00 Ų |
| XlogP | -3.50 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.15% | 96.09% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.94% | 91.11% |
| CHEMBL226 | P30542 | Adenosine A1 receptor | 96.24% | 95.93% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 95.65% | 97.09% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 95.54% | 97.25% |
| CHEMBL2955 | O95136 | Sphingosine 1-phosphate receptor Edg-5 | 95.26% | 92.86% |
| CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 94.48% | 96.61% |
| CHEMBL204 | P00734 | Thrombin | 94.23% | 96.01% |
| CHEMBL4581 | P52732 | Kinesin-like protein 1 | 93.53% | 93.18% |
| CHEMBL3892 | Q99500 | Sphingosine 1-phosphate receptor Edg-3 | 93.09% | 97.29% |
| CHEMBL233 | P35372 | Mu opioid receptor | 93.01% | 97.93% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 92.71% | 94.45% |
| CHEMBL2996 | Q05655 | Protein kinase C delta | 91.71% | 97.79% |
| CHEMBL237 | P41145 | Kappa opioid receptor | 91.64% | 98.10% |
| CHEMBL4681 | P42330 | Aldo-keto-reductase family 1 member C3 | 91.48% | 89.05% |
| CHEMBL220 | P22303 | Acetylcholinesterase | 91.26% | 94.45% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 90.83% | 100.00% |
| CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 90.13% | 96.21% |
| CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 89.84% | 96.77% |
| CHEMBL2094135 | Q96BI3 | Gamma-secretase | 89.13% | 98.05% |
| CHEMBL2534 | O15530 | 3-phosphoinositide dependent protein kinase-1 | 89.06% | 95.36% |
| CHEMBL4302 | P08183 | P-glycoprotein 1 | 88.03% | 92.98% |
| CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 88.01% | 96.47% |
| CHEMBL2360 | P00492 | Hypoxanthine-guanine phosphoribosyltransferase | 87.93% | 87.38% |
| CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 87.32% | 95.50% |
| CHEMBL2072 | P35499 | Sodium channel protein type IV alpha subunit | 86.73% | 92.32% |
| CHEMBL1871 | P10275 | Androgen Receptor | 86.20% | 96.43% |
| CHEMBL6136 | O60341 | Lysine-specific histone demethylase 1 | 85.85% | 95.58% |
| CHEMBL206 | P03372 | Estrogen receptor alpha | 85.49% | 97.64% |
| CHEMBL4618 | P09960 | Leukotriene A4 hydrolase | 84.85% | 97.86% |
| CHEMBL5888 | Q99558 | Mitogen-activated protein kinase kinase kinase 14 | 84.60% | 100.00% |
| CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 84.11% | 95.89% |
| CHEMBL5255 | O00206 | Toll-like receptor 4 | 84.08% | 92.50% |
| CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 83.95% | 100.00% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 83.62% | 89.00% |
| CHEMBL2140 | P48775 | Tryptophan 2,3-dioxygenase | 83.49% | 98.46% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 82.62% | 95.89% |
| CHEMBL5163 | Q9NY46 | Sodium channel protein type III alpha subunit | 82.11% | 96.90% |
| CHEMBL3430907 | Q96GD4 | Aurora kinase B/Inner centromere protein | 81.84% | 97.50% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 81.82% | 92.94% |
| CHEMBL1075162 | Q13304 | Uracil nucleotide/cysteinyl leukotriene receptor | 81.61% | 80.33% |
| CHEMBL5524 | Q99873 | Protein-arginine N-methyltransferase 1 | 81.33% | 96.67% |
| CHEMBL344 | Q99705 | Melanin-concentrating hormone receptor 1 | 81.25% | 92.50% |
| CHEMBL2842 | P42345 | Serine/threonine-protein kinase mTOR | 81.03% | 92.78% |
| CHEMBL1914 | P06276 | Butyrylcholinesterase | 80.54% | 95.00% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 80.04% | 97.14% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Asparagus filicinus |
| PubChem | 101688666 |
| LOTUS | LTS0061364 |
| wikiData | Q105134922 |