Ac-Tyr-Gly-Asn-Thr(1)-Met-Lys(2)-Tyr-Pro-Ser-Asp(1)-Trp-Glu(OMe)-Glu(2)-Tyr-OH
Internal ID | 1902e6d2-db1f-4645-85de-bf8f24584c0d |
Taxonomy | Organic Polymers > Polypeptides |
IUPAC Name | (2S)-2-[[(1S,4S,7S,10S,19S,22S,28S,31S,37R,38S,41S)-38-[[(2S)-2-[[2-[[(2S)-2-acetamido-3-(4-hydroxyphenyl)propanoyl]amino]acetyl]amino]-4-amino-4-oxobutanoyl]amino]-31-(hydroxymethyl)-22-[(4-hydroxyphenyl)methyl]-4-(1H-indol-3-ylmethyl)-7-(3-methoxy-3-oxopropyl)-37-methyl-41-(2-methylsulfanylethyl)-2,5,8,13,20,23,29,32,35,39,42-undecaoxo-36-oxa-3,6,9,14,21,24,30,33,40,43-decazatricyclo[17.14.10.024,28]tritetracontane-10-carbonyl]amino]-3-(4-hydroxyphenyl)propanoic acid |
SMILES (Canonical) | CC1C(C(=O)NC(C(=O)NC2CCCCNC(=O)CCC(NC(=O)C(NC(=O)C(NC(=O)C(CC(=O)O1)NC(=O)C(NC(=O)C3CCCN3C(=O)C(NC2=O)CC4=CC=C(C=C4)O)CO)CC5=CNC6=CC=CC=C65)CCC(=O)OC)C(=O)NC(CC7=CC=C(C=C7)O)C(=O)O)CCSC)NC(=O)C(CC(=O)N)NC(=O)CNC(=O)C(CC8=CC=C(C=C8)O)NC(=O)C |
SMILES (Isomeric) | C[C@@H]1[C@@H](C(=O)N[C@H](C(=O)N[C@H]2CCCCNC(=O)CC[C@H](NC(=O)[C@@H](NC(=O)[C@@H](NC(=O)[C@H](CC(=O)O1)NC(=O)[C@@H](NC(=O)[C@@H]3CCCN3C(=O)[C@@H](NC2=O)CC4=CC=C(C=C4)O)CO)CC5=CNC6=CC=CC=C65)CCC(=O)OC)C(=O)N[C@@H](CC7=CC=C(C=C7)O)C(=O)O)CCSC)NC(=O)[C@H](CC(=O)N)NC(=O)CNC(=O)[C@H](CC8=CC=C(C=C8)O)NC(=O)C |
InChI | InChI=1S/C84H107N17O26S/c1-43-71(100-79(119)60(38-66(85)107)90-68(109)41-88-72(112)58(89-44(2)103)34-45-14-20-49(104)21-15-45)82(122)94-57(30-33-128-4)76(116)91-54-12-7-8-31-86-67(108)28-26-55(75(115)98-63(84(124)125)36-47-18-24-51(106)25-19-47)92-74(114)56(27-29-69(110)126-3)93-77(117)59(37-48-40-87-53-11-6-5-10-52(48)53)95-78(118)61(39-70(111)127-43)96-80(120)64(42-102)99-81(121)65-13-9-32-101(65)83(123)62(97-73(54)113)35-46-16-22-50(105)23-17-46/h5-6,10-11,14-25,40,43,54-65,71,87,102,104-106H,7-9,12-13,26-39,41-42H2,1-4H3,(H2,85,107)(H,86,108)(H,88,112)(H,89,103)(H,90,109)(H,91,116)(H,92,114)(H,93,117)(H,94,122)(H,95,118)(H,96,120)(H,97,113)(H,98,115)(H,99,121)(H,100,119)(H,124,125)/t43-,54+,55+,56+,57+,58+,59+,60+,61+,62+,63+,64+,65+,71+/m1/s1 |
InChI Key | YEJXJFKDCRKSRQ-LBHOYRLISA-N |
Popularity | 0 references in papers |
Molecular Formula | C84H107N17O26S |
Molecular Weight | 1802.90 g/mol |
Exact Mass | 1801.72938776 g/mol |
Topological Polar Surface Area (TPSA) | 683.00 Ų |
XlogP | -1.00 |
Atomic LogP (AlogP) | -4.43 |
H-Bond Acceptor | 26 |
H-Bond Donor | 21 |
Rotatable Bonds | 27 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
Human Intestinal Absorption | + | 0.7001 | 70.01% |
Caco-2 | - | 0.8639 | 86.39% |
Blood Brain Barrier | - | 0.9750 | 97.50% |
Human oral bioavailability | - | 0.6857 | 68.57% |
Subcellular localzation | Nucleus | 0.3992 | 39.92% |
OATP2B1 inhibitior | - | 1.0000 | 100.00% |
OATP1B1 inhibitior | + | 0.7968 | 79.68% |
OATP1B3 inhibitior | + | 0.9259 | 92.59% |
MATE1 inhibitior | - | 0.8209 | 82.09% |
OCT2 inhibitior | - | 0.8250 | 82.50% |
BSEP inhibitior | + | 0.9672 | 96.72% |
P-glycoprotein inhibitior | + | 0.7419 | 74.19% |
P-glycoprotein substrate | + | 0.8707 | 87.07% |
CYP3A4 substrate | + | 0.7641 | 76.41% |
CYP2C9 substrate | - | 1.0000 | 100.00% |
CYP2D6 substrate | - | 0.8520 | 85.20% |
CYP3A4 inhibition | - | 0.6265 | 62.65% |
CYP2C9 inhibition | - | 0.8533 | 85.33% |
CYP2C19 inhibition | - | 0.8862 | 88.62% |
CYP2D6 inhibition | - | 0.8371 | 83.71% |
CYP1A2 inhibition | - | 0.9108 | 91.08% |
CYP2C8 inhibition | + | 0.8619 | 86.19% |
CYP inhibitory promiscuity | - | 0.7664 | 76.64% |
UGT catelyzed | + | 0.8000 | 80.00% |
Carcinogenicity (binary) | - | 0.8700 | 87.00% |
Carcinogenicity (trinary) | Non-required | 0.5895 | 58.95% |
Eye corrosion | - | 0.9882 | 98.82% |
Eye irritation | - | 0.8954 | 89.54% |
Skin irritation | - | 0.7796 | 77.96% |
Skin corrosion | - | 0.9345 | 93.45% |
Ames mutagenesis | - | 0.6100 | 61.00% |
Human Ether-a-go-go-Related Gene inhibition | + | 0.7097 | 70.97% |
Micronuclear | + | 0.8200 | 82.00% |
Hepatotoxicity | - | 0.5835 | 58.35% |
skin sensitisation | - | 0.8824 | 88.24% |
Respiratory toxicity | + | 0.7778 | 77.78% |
Reproductive toxicity | + | 0.9889 | 98.89% |
Mitochondrial toxicity | + | 0.9500 | 95.00% |
Nephrotoxicity | - | 0.6863 | 68.63% |
Acute Oral Toxicity (c) | III | 0.5414 | 54.14% |
Estrogen receptor binding | - | 0.5491 | 54.91% |
Androgen receptor binding | + | 0.6466 | 64.66% |
Thyroid receptor binding | + | 0.7988 | 79.88% |
Glucocorticoid receptor binding | + | 0.8431 | 84.31% |
Aromatase binding | + | 0.8210 | 82.10% |
PPAR gamma | + | 0.7659 | 76.59% |
Honey bee toxicity | - | 0.6070 | 60.70% |
Biodegradation | - | 0.8500 | 85.00% |
Crustacea aquatic toxicity | - | 0.5400 | 54.00% |
Fish aquatic toxicity | + | 0.8691 | 86.91% |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL2581 | P07339 | Cathepsin D | 99.99% | 98.95% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.95% | 91.11% |
CHEMBL1255126 | O15151 | Protein Mdm4 | 98.71% | 90.20% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.57% | 96.09% |
CHEMBL259 | P32245 | Melanocortin receptor 4 | 98.45% | 95.38% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 98.41% | 85.14% |
CHEMBL2693 | Q9UIQ6 | Cystinyl aminopeptidase | 98.21% | 97.64% |
CHEMBL4608 | P33032 | Melanocortin receptor 5 | 98.05% | 97.00% |
CHEMBL4644 | P41968 | Melanocortin receptor 3 | 97.86% | 99.52% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 97.04% | 97.14% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 96.92% | 97.09% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 96.79% | 99.17% |
CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 96.33% | 90.08% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 95.63% | 94.45% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 95.41% | 99.23% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 94.85% | 89.00% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 94.68% | 95.89% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 94.58% | 91.19% |
CHEMBL4777 | P25929 | Neuropeptide Y receptor type 1 | 94.27% | 96.67% |
CHEMBL3476 | O15111 | Inhibitor of nuclear factor kappa B kinase alpha subunit | 93.49% | 95.83% |
CHEMBL4040 | P28482 | MAP kinase ERK2 | 93.47% | 83.82% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 93.40% | 95.56% |
CHEMBL5043 | Q6P179 | Endoplasmic reticulum aminopeptidase 2 | 93.38% | 91.81% |
CHEMBL2535 | P11166 | Glucose transporter | 93.10% | 98.75% |
CHEMBL2069156 | Q14145 | Kelch-like ECH-associated protein 1 | 93.07% | 82.38% |
CHEMBL3310 | Q96DB2 | Histone deacetylase 11 | 92.71% | 88.56% |
CHEMBL321 | P14780 | Matrix metalloproteinase 9 | 92.13% | 92.12% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 91.52% | 95.50% |
CHEMBL2413 | P32246 | C-C chemokine receptor type 1 | 90.15% | 89.50% |
CHEMBL3830 | Q2M2I8 | Adaptor-associated kinase | 89.00% | 83.10% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 88.66% | 99.15% |
CHEMBL2000 | P03952 | Plasma kallikrein | 88.60% | 93.92% |
CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 88.39% | 91.71% |
CHEMBL333 | P08253 | Matrix metalloproteinase-2 | 88.22% | 96.31% |
CHEMBL4296 | Q15858 | Sodium channel protein type IX alpha subunit | 87.02% | 96.11% |
CHEMBL4101 | P17612 | cAMP-dependent protein kinase alpha-catalytic subunit | 86.63% | 82.86% |
CHEMBL4394 | Q9NYA1 | Sphingosine kinase 1 | 85.97% | 96.03% |
CHEMBL3024 | P53350 | Serine/threonine-protein kinase PLK1 | 84.86% | 97.43% |
CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 84.24% | 95.50% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 84.08% | 92.94% |
CHEMBL2095172 | P14867 | GABA-A receptor; alpha-1/beta-2/gamma-2 | 83.75% | 92.67% |
CHEMBL5163 | Q9NY46 | Sodium channel protein type III alpha subunit | 83.37% | 96.90% |
CHEMBL1744525 | P43490 | Nicotinamide phosphoribosyltransferase | 82.76% | 96.25% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 82.56% | 86.33% |
CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 82.55% | 100.00% |
CHEMBL4588 | P22894 | Matrix metalloproteinase 8 | 82.26% | 94.66% |
CHEMBL5939 | Q9NZ08 | Endoplasmic reticulum aminopeptidase 1 | 82.10% | 100.00% |
CHEMBL3891 | P07384 | Calpain 1 | 81.57% | 93.04% |
CHEMBL216 | P11229 | Muscarinic acetylcholine receptor M1 | 81.54% | 94.23% |
CHEMBL2094135 | Q96BI3 | Gamma-secretase | 80.64% | 98.05% |
CHEMBL6175 | Q9H3R0 | Lysine-specific demethylase 4C | 80.64% | 96.69% |
CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 80.55% | 93.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Elsholtzia bodinieri |
Ipomoea purpurea |