Abiesinol E; Listvenol
Internal ID | 73feb391-7a79-43c7-b020-331f1cb51ec4 |
Taxonomy | Phenylpropanoids and polyketides > 2-arylbenzofuran flavonoids |
IUPAC Name | 3',4,5',6-tetrahydroxy-2,2'-bis(4-hydroxyphenyl)spiro[2H-1-benzofuran-3,9'-3,4-dihydro-2H-furo[2,3-h]chromene]-8'-one |
SMILES (Canonical) | C1C(C(OC2=C1C(=CC3=C2C4(C(OC5=CC(=CC(=C54)O)O)C6=CC=C(C=C6)O)C(=O)O3)O)C7=CC=C(C=C7)O)O |
SMILES (Isomeric) | C1C(C(OC2=C1C(=CC3=C2C4(C(OC5=CC(=CC(=C54)O)O)C6=CC=C(C=C6)O)C(=O)O3)O)C7=CC=C(C=C7)O)O |
InChI | InChI=1S/C30H22O10/c31-15-5-1-13(2-6-15)26-21(36)11-18-19(34)12-23-25(27(18)40-26)30(29(37)39-23)24-20(35)9-17(33)10-22(24)38-28(30)14-3-7-16(32)8-4-14/h1-10,12,21,26,28,31-36H,11H2 |
InChI Key | RNDNBGULZNCSNB-UHFFFAOYSA-N |
Popularity | 1 reference in papers |
Molecular Formula | C30H22O10 |
Molecular Weight | 542.50 g/mol |
Exact Mass | 542.12129689 g/mol |
Topological Polar Surface Area (TPSA) | 166.00 Ų |
XlogP | 3.30 |
Abiesinol E; Listvenol |
3,2'-Epilarixinol |
101046-79-1 |
1207671-28-0 |
AKOS040761972 |
![2D Structure of Abiesinol E; Listvenol 2D Structure of Abiesinol E; Listvenol](https://plantaedb.com/storage/docs/compounds/2023/11/abiesinol-e-listvenol.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.29% | 91.11% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 95.32% | 95.56% |
CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 93.89% | 93.40% |
CHEMBL2581 | P07339 | Cathepsin D | 93.65% | 98.95% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 93.47% | 94.45% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 92.80% | 96.09% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 92.55% | 97.09% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 89.44% | 89.00% |
CHEMBL2553 | Q15418 | Ribosomal protein S6 kinase alpha 1 | 89.43% | 85.11% |
CHEMBL2535 | P11166 | Glucose transporter | 89.23% | 98.75% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 88.30% | 99.23% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 87.57% | 86.33% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 86.96% | 99.15% |
CHEMBL3401 | O75469 | Pregnane X receptor | 86.74% | 94.73% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 85.59% | 95.89% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 85.15% | 91.49% |
CHEMBL236 | P41143 | Delta opioid receptor | 81.34% | 99.35% |
CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 80.30% | 93.99% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Abies sachalinensis |
Yucca schidigera |
PubChem | 73822597 |
LOTUS | LTS0151717 |
wikiData | Q105241267 |