(2S,3R)-2-(2,4-dihydroxyphenyl)-3,7-dihydroxy-5-methoxy-8-[(2S)-5-methyl-2-prop-1-en-2-ylhex-4-enyl]-2,3-dihydrochromen-4-one
Internal ID | 00b1bec7-dbbf-4dbc-a284-71d4cd55e1a8 |
Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Flavans > 8-prenylated flavans > 8-prenylated flavanones |
IUPAC Name | (2S,3R)-2-(2,4-dihydroxyphenyl)-3,7-dihydroxy-5-methoxy-8-[(2S)-5-methyl-2-prop-1-en-2-ylhex-4-enyl]-2,3-dihydrochromen-4-one |
SMILES (Canonical) | CC(=CCC(CC1=C2C(=C(C=C1O)OC)C(=O)C(C(O2)C3=C(C=C(C=C3)O)O)O)C(=C)C)C |
SMILES (Isomeric) | CC(=CC[C@@H](CC1=C2C(=C(C=C1O)OC)C(=O)[C@@H]([C@@H](O2)C3=C(C=C(C=C3)O)O)O)C(=C)C)C |
InChI | InChI=1S/C26H30O7/c1-13(2)6-7-15(14(3)4)10-18-20(29)12-21(32-5)22-23(30)24(31)26(33-25(18)22)17-9-8-16(27)11-19(17)28/h6,8-9,11-12,15,24,26-29,31H,3,7,10H2,1-2,4-5H3/t15-,24-,26-/m0/s1 |
InChI Key | QKEDJCCCNZWOBS-CDAVKZRYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C26H30O7 |
Molecular Weight | 454.50 g/mol |
Exact Mass | 454.19915329 g/mol |
Topological Polar Surface Area (TPSA) | 116.00 Ų |
XlogP | 5.00 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.08% | 91.11% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 95.42% | 91.49% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 95.39% | 95.56% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 94.99% | 94.45% |
CHEMBL2581 | P07339 | Cathepsin D | 94.05% | 98.95% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 93.96% | 86.33% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 92.74% | 99.17% |
CHEMBL3401 | O75469 | Pregnane X receptor | 91.53% | 94.73% |
CHEMBL2535 | P11166 | Glucose transporter | 91.43% | 98.75% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 90.02% | 96.09% |
CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 89.42% | 93.99% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 89.32% | 89.00% |
CHEMBL1255126 | O15151 | Protein Mdm4 | 87.01% | 90.20% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 86.79% | 95.89% |
CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 86.25% | 91.07% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 85.90% | 95.89% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 85.38% | 94.00% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 83.92% | 91.19% |
CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 81.75% | 89.62% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 81.52% | 99.23% |
CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 80.33% | 97.21% |
CHEMBL4306 | P22460 | Voltage-gated potassium channel subunit Kv1.5 | 80.28% | 94.03% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Fraxinus angustifolia |
Ligustrum japonicum |
Olea europaea |
Sophora flavescens |
PubChem | 133612301 |
LOTUS | LTS0125980 |
wikiData | Q105212042 |