2-[4-[16-[3,4-Dihydroxy-5-[5-hydroxy-6-(hydroxymethyl)-3-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-4-(3,4,5-trihydroxyoxan-2-yl)oxyoxan-2-yl]oxy-6-(hydroxymethyl)oxan-2-yl]oxy-6,15-dihydroxy-7,9,13-trimethyl-5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icos-18-en-6-yl]-2-methylbutoxy]-6-(hydroxymethyl)oxane-3,4,5-triol
Internal ID | 9db4d7bd-771a-4aa5-a983-42258d177c1d |
Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Steroidal glycosides > Steroidal saponins |
IUPAC Name | 2-[4-[16-[3,4-dihydroxy-5-[5-hydroxy-6-(hydroxymethyl)-3-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-4-(3,4,5-trihydroxyoxan-2-yl)oxyoxan-2-yl]oxy-6-(hydroxymethyl)oxan-2-yl]oxy-6,15-dihydroxy-7,9,13-trimethyl-5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icos-18-en-6-yl]-2-methylbutoxy]-6-(hydroxymethyl)oxane-3,4,5-triol |
SMILES (Canonical) | CC1C2C(CC3C2(CCC4C3CC=C5C4(CC(C(C5)OC6C(C(C(C(O6)CO)OC7C(C(C(C(O7)CO)O)OC8C(C(C(CO8)O)O)O)OC9C(C(C(C(O9)CO)O)O)O)O)O)O)C)C)OC1(CCC(C)COC1C(C(C(C(O1)CO)O)O)O)O |
SMILES (Isomeric) | CC1C2C(CC3C2(CCC4C3CC=C5C4(CC(C(C5)OC6C(C(C(C(O6)CO)OC7C(C(C(C(O7)CO)O)OC8C(C(C(CO8)O)O)O)OC9C(C(C(C(O9)CO)O)O)O)O)O)O)C)C)OC1(CCC(C)COC1C(C(C(C(O1)CO)O)O)O)O |
InChI | InChI=1S/C56H92O29/c1-20(18-75-49-43(71)39(67)36(64)30(14-57)78-49)7-10-56(74)21(2)34-29(85-56)12-25-23-6-5-22-11-28(26(61)13-55(22,4)24(23)8-9-54(25,34)3)77-51-45(73)41(69)46(33(17-60)81-51)82-53-48(84-52-44(72)40(68)37(65)31(15-58)79-52)47(38(66)32(16-59)80-53)83-50-42(70)35(63)27(62)19-76-50/h5,20-21,23-53,57-74H,6-19H2,1-4H3 |
InChI Key | SCWLDKDBGIKBOV-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C56H92O29 |
Molecular Weight | 1229.30 g/mol |
Exact Mass | 1228.57242689 g/mol |
Topological Polar Surface Area (TPSA) | 466.00 Ų |
XlogP | -4.80 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.66% | 96.09% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.55% | 91.11% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 98.35% | 95.93% |
CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 95.24% | 96.61% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 94.72% | 97.09% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 93.49% | 90.17% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 92.90% | 94.45% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 92.88% | 100.00% |
CHEMBL2955 | O95136 | Sphingosine 1-phosphate receptor Edg-5 | 92.87% | 92.86% |
CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 89.52% | 93.56% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 88.84% | 95.89% |
CHEMBL3892 | Q99500 | Sphingosine 1-phosphate receptor Edg-3 | 88.80% | 97.29% |
CHEMBL1914 | P06276 | Butyrylcholinesterase | 88.37% | 95.00% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 87.84% | 95.89% |
CHEMBL1907602 | P06493 | Cyclin-dependent kinase 1/cyclin B1 | 87.38% | 91.24% |
CHEMBL4681 | P42330 | Aldo-keto-reductase family 1 member C3 | 86.62% | 89.05% |
CHEMBL2996 | Q05655 | Protein kinase C delta | 86.29% | 97.79% |
CHEMBL2581 | P07339 | Cathepsin D | 85.93% | 98.95% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 85.77% | 89.00% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 85.76% | 97.25% |
CHEMBL1821 | P08173 | Muscarinic acetylcholine receptor M4 | 85.66% | 94.08% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 85.66% | 92.50% |
CHEMBL2360 | P00492 | Hypoxanthine-guanine phosphoribosyltransferase | 85.64% | 87.38% |
CHEMBL4581 | P52732 | Kinesin-like protein 1 | 85.22% | 93.18% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 85.12% | 86.33% |
CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 83.18% | 95.50% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 82.90% | 97.14% |
CHEMBL3713062 | P10646 | Tissue factor pathway inhibitor | 80.89% | 97.33% |
CHEMBL1907605 | P24864 | Cyclin-dependent kinase 2/cyclin E1 | 80.63% | 92.88% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 80.53% | 94.00% |
CHEMBL3401 | O75469 | Pregnane X receptor | 80.51% | 94.73% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 80.22% | 94.75% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 80.11% | 100.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Allium karataviense |
PubChem | 162910909 |
LOTUS | LTS0037210 |
wikiData | Q105250464 |