10-(4-hydroxy-3,5-dimethoxyphenyl)-1-methoxy-6,9,10,11-tetrahydro-5H-naphtho[1,2-g]chromene-3,11-diol
| Internal ID | 044eaab8-3b81-430b-bd24-3e24e74b4020 |
| Taxonomy | Phenylpropanoids and polyketides > Isoflavonoids > O-methylated isoflavonoids > 3-O-methylated isoflavonoids |
| IUPAC Name | 10-(4-hydroxy-3,5-dimethoxyphenyl)-1-methoxy-6,9,10,11-tetrahydro-5H-naphtho[1,2-g]chromene-3,11-diol |
| SMILES (Canonical) | COC1=CC(=CC(=C1O)OC)C2COC3=C(C2O)C=C4C(=C3)CCC5=C4C(=CC(=C5)O)OC |
| SMILES (Isomeric) | COC1=CC(=CC(=C1O)OC)C2COC3=C(C2O)C=C4C(=C3)CCC5=C4C(=CC(=C5)O)OC |
| InChI | InChI=1S/C26H26O7/c1-30-21-10-16(27)6-14-5-4-13-7-20-18(11-17(13)24(14)21)25(28)19(12-33-20)15-8-22(31-2)26(29)23(9-15)32-3/h6-11,19,25,27-29H,4-5,12H2,1-3H3 |
| InChI Key | UQRXDLDKKPPLEI-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C26H26O7 |
| Molecular Weight | 450.50 g/mol |
| Exact Mass | 450.16785316 g/mol |
| Topological Polar Surface Area (TPSA) | 97.60 Ų |
| XlogP | 3.70 |
| There are no found synonyms. |
![2D Structure of 10-(4-hydroxy-3,5-dimethoxyphenyl)-1-methoxy-6,9,10,11-tetrahydro-5H-naphtho[1,2-g]chromene-3,11-diol](https://plantaedb.com/storage/docs/compounds/2023/11/a85e4200-8691-11ee-ac64-bdd53224ecf0.jpg "2D Structure of 10-(4-hydroxy-3,5-dimethoxyphenyl)-1-methoxy-6,9,10,11-tetrahydro-5H-naphtho[1,2-g]chromene-3,11-diol")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.15% | 91.11% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.36% | 96.09% |
| CHEMBL2581 | P07339 | Cathepsin D | 93.81% | 98.95% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 92.91% | 86.33% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 90.35% | 85.14% |
| CHEMBL5311 | P37023 | Serine/threonine-protein kinase receptor R3 | 89.68% | 82.67% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 89.57% | 97.09% |
| CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 89.09% | 95.89% |
| CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 88.85% | 92.62% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 88.70% | 99.17% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 88.05% | 100.00% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 87.93% | 95.89% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 87.89% | 89.00% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 87.72% | 90.00% |
| CHEMBL5339 | Q5NUL3 | G-protein coupled receptor 120 | 86.82% | 95.78% |
| CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 85.39% | 89.62% |
| CHEMBL2056 | P21728 | Dopamine D1 receptor | 84.50% | 91.00% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 84.08% | 91.49% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 84.06% | 94.45% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 82.30% | 95.56% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 82.22% | 92.94% |
| CHEMBL215 | P09917 | Arachidonate 5-lipoxygenase | 81.73% | 92.68% |
| CHEMBL4306 | P22460 | Voltage-gated potassium channel subunit Kv1.5 | 81.72% | 94.03% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 81.11% | 90.71% |
| CHEMBL2413 | P32246 | C-C chemokine receptor type 1 | 80.31% | 89.50% |
| CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 80.00% | 96.95% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Alstonia rostrata |
| Pleione bulbocodioides |
| PubChem | 163031596 |
| LOTUS | LTS0096184 |
| wikiData | Q105245936 |