[(2S)-1-hexadecanoyloxy-3-[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-[[(2S,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxymethyl]oxan-2-yl]oxypropan-2-yl] (Z)-octadec-9-enoate
Internal ID | 38c56bcb-4d68-432e-a8dd-2af6342ba7e2 |
Taxonomy | Lipids and lipid-like molecules > Glycerolipids > Glycosylglycerols > Glycosyldiacylglycerols |
IUPAC Name | [(2S)-1-hexadecanoyloxy-3-[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-[[(2S,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxymethyl]oxan-2-yl]oxypropan-2-yl] (Z)-octadec-9-enoate |
SMILES (Canonical) | CCCCCCCCCCCCCCCC(=O)OCC(COC1C(C(C(C(O1)COC2C(C(C(C(O2)CO)O)O)O)O)O)O)OC(=O)CCCCCCCC=CCCCCCCCC |
SMILES (Isomeric) | CCCCCCCCCCCCCCCC(=O)OC[C@H](CO[C@H]1[C@@H]([C@H]([C@H]([C@H](O1)CO[C@@H]2[C@@H]([C@H]([C@H]([C@H](O2)CO)O)O)O)O)O)O)OC(=O)CCCCCCC/C=C\CCCCCCCC |
InChI | InChI=1S/C49H90O15/c1-3-5-7-9-11-13-15-17-18-20-22-24-26-28-30-32-41(52)62-37(34-59-40(51)31-29-27-25-23-21-19-16-14-12-10-8-6-4-2)35-60-48-47(58)45(56)43(54)39(64-48)36-61-49-46(57)44(55)42(53)38(33-50)63-49/h17-18,37-39,42-50,53-58H,3-16,19-36H2,1-2H3/b18-17-/t37-,38-,39-,42+,43+,44+,45+,46-,47-,48-,49+/m1/s1 |
InChI Key | JRCZTCGPEBCBPF-KSUIPSQJSA-N |
Popularity | 0 references in papers |
Molecular Formula | C49H90O15 |
Molecular Weight | 919.20 g/mol |
Exact Mass | 918.62797216 g/mol |
Topological Polar Surface Area (TPSA) | 231.00 Ų |
XlogP | 10.50 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 99.02% | 99.17% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 96.77% | 92.50% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.35% | 96.09% |
CHEMBL2265 | P23141 | Acyl coenzyme A:cholesterol acyltransferase | 96.07% | 85.94% |
CHEMBL2581 | P07339 | Cathepsin D | 94.45% | 98.95% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 94.27% | 91.11% |
CHEMBL4769 | O95749 | Geranylgeranyl pyrophosphate synthetase | 91.00% | 92.08% |
CHEMBL299 | P17252 | Protein kinase C alpha | 90.79% | 98.03% |
CHEMBL3892 | Q99500 | Sphingosine 1-phosphate receptor Edg-3 | 90.38% | 97.29% |
CHEMBL3475 | P05121 | Plasminogen activator inhibitor-1 | 89.78% | 83.00% |
CHEMBL3401 | O75469 | Pregnane X receptor | 88.89% | 94.73% |
CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 88.53% | 96.47% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 88.49% | 96.00% |
CHEMBL2955 | O95136 | Sphingosine 1-phosphate receptor Edg-5 | 87.92% | 92.86% |
CHEMBL2072 | P35499 | Sodium channel protein type IV alpha subunit | 87.02% | 92.32% |
CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 86.96% | 96.95% |
CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 86.22% | 100.00% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 85.34% | 100.00% |
CHEMBL1293316 | Q9HBX9 | Relaxin receptor 1 | 84.58% | 82.50% |
CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 84.55% | 93.56% |
CHEMBL335 | P18031 | Protein-tyrosine phosphatase 1B | 83.25% | 95.17% |
CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 83.18% | 94.33% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 82.34% | 89.00% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 81.72% | 91.19% |
CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 81.16% | 95.50% |
CHEMBL220 | P22303 | Acetylcholinesterase | 80.57% | 94.45% |
CHEMBL5043 | Q6P179 | Endoplasmic reticulum aminopeptidase 2 | 80.54% | 91.81% |
CHEMBL5163 | Q9NY46 | Sodium channel protein type III alpha subunit | 80.51% | 96.90% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Arisaema amurense |
PubChem | 10557725 |
LOTUS | LTS0184297 |
wikiData | Q105133843 |