[3,4-Diacetyloxy-20-(furan-3-yl)-5,14,19-trimethyl-8,22-dioxo-9,13,15,21,25-pentaoxaoctacyclo[12.10.1.15,12.01,16.03,12.06,11.011,16.019,24]hexacos-23-en-2-yl] propanoate
| Internal ID | 61c24b08-67fc-45d4-84c2-788d8455721e |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Triterpenoids > Limonoids |
| IUPAC Name | [3,4-diacetyloxy-20-(furan-3-yl)-5,14,19-trimethyl-8,22-dioxo-9,13,15,21,25-pentaoxaoctacyclo[12.10.1.15,12.01,16.03,12.06,11.011,16.019,24]hexacos-23-en-2-yl] propanoate |
| SMILES (Canonical) | CCC(=O)OC1C2(C(C3(CC24C5(C3CC(=O)OC5)C67C1(C8=CC(=O)OC(C8(CC6)C)C9=COC=C9)OC(O7)(O4)C)C)OC(=O)C)OC(=O)C |
| SMILES (Isomeric) | CCC(=O)OC1C2(C(C3(CC24C5(C3CC(=O)OC5)C67C1(C8=CC(=O)OC(C8(CC6)C)C9=COC=C9)OC(O7)(O4)C)C)OC(=O)C)OC(=O)C |
| InChI | InChI=1S/C35H38O14/c1-7-22(38)45-27-34-21-13-24(40)44-25(19-8-11-41-14-19)28(21,4)9-10-32(34)31-16-42-23(39)12-20(31)29(5)15-33(31,48-30(6,47-32)49-34)35(27,46-18(3)37)26(29)43-17(2)36/h8,11,13-14,20,25-27H,7,9-10,12,15-16H2,1-6H3 |
| InChI Key | QZUIJRKASIZSMV-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C35H38O14 |
| Molecular Weight | 682.70 g/mol |
| Exact Mass | 682.22615588 g/mol |
| Topological Polar Surface Area (TPSA) | 172.00 Ų |
| XlogP | 1.10 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 98.79% | 94.45% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.08% | 91.11% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.95% | 96.09% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 93.90% | 89.00% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 93.87% | 85.14% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 92.48% | 97.09% |
| CHEMBL2581 | P07339 | Cathepsin D | 92.28% | 98.95% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 92.26% | 97.25% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 91.28% | 90.17% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 88.78% | 100.00% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 86.96% | 99.23% |
| CHEMBL4051 | P13569 | Cystic fibrosis transmembrane conductance regulator | 86.92% | 95.71% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 84.36% | 86.33% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 81.19% | 90.00% |
| CHEMBL3922 | P50579 | Methionine aminopeptidase 2 | 81.07% | 97.28% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Carapa guianensis |
| PubChem | 75607046 |
| LOTUS | LTS0201810 |
| wikiData | Q105232387 |