2-[[(1R,7R,8S,26R,28R,29R,38R)-1,13,14,15,18,19,20,34,35,39,39-undecahydroxy-2,5,10,23,31-pentaoxo-6,9,24,27,30,40-hexaoxaoctacyclo[34.3.1.04,38.07,26.08,29.011,16.017,22.032,37]tetraconta-3,11,13,15,17,19,21,32,34,36-decaen-28-yl]oxymethyl]prop-2-enenitrile
Internal ID | 8768e770-facd-4e1b-a1b4-6a1809e248d4 |
Taxonomy | Phenylpropanoids and polyketides > Tannins > Hydrolyzable tannins |
IUPAC Name | 2-[[(1R,7R,8S,26R,28R,29R,38R)-1,13,14,15,18,19,20,34,35,39,39-undecahydroxy-2,5,10,23,31-pentaoxo-6,9,24,27,30,40-hexaoxaoctacyclo[34.3.1.04,38.07,26.08,29.011,16.017,22.032,37]tetraconta-3,11,13,15,17,19,21,32,34,36-decaen-28-yl]oxymethyl]prop-2-enenitrile |
SMILES (Canonical) | C=C(COC1C2C3C(C(O1)COC(=O)C4=CC(=C(C(=C4C5=C(C(=C(C=C5C(=O)O3)O)O)O)O)O)O)OC(=O)C6=CC(=O)C7(C(C6C8=C(O7)C(=C(C=C8C(=O)O2)O)O)(O)O)O)C#N |
SMILES (Isomeric) | C=C(CO[C@H]1[C@H]2[C@@H]3[C@@H]([C@H](O1)COC(=O)C4=CC(=C(C(=C4C5=C(C(=C(C=C5C(=O)O3)O)O)O)O)O)O)OC(=O)C6=CC(=O)[C@]7(C([C@@H]6C8=C(O7)C(=C(C=C8C(=O)O2)O)O)(O)O)O)C#N |
InChI | InChI=1S/C38H27NO23/c1-9(6-39)7-57-36-31-30-28(59-35(52)13-5-18(43)38(55)37(53,54)22(13)21-12(34(51)61-31)4-16(42)25(46)29(21)62-38)17(58-36)8-56-32(49)10-2-14(40)23(44)26(47)19(10)20-11(33(50)60-30)3-15(41)24(45)27(20)48/h2-5,17,22,28,30-31,36,40-42,44-48,53-55H,1,7-8H2/t17-,22+,28-,30+,31-,36-,38+/m1/s1 |
InChI Key | CCIHZFMRYZSRTN-TWWAIRJUSA-N |
Popularity | 0 references in papers |
Molecular Formula | C38H27NO23 |
Molecular Weight | 865.60 g/mol |
Exact Mass | 865.09738611 g/mol |
Topological Polar Surface Area (TPSA) | 396.00 Ų |
XlogP | -1.10 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.71% | 91.11% |
CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 95.25% | 96.38% |
CHEMBL230 | P35354 | Cyclooxygenase-2 | 93.81% | 89.63% |
CHEMBL2581 | P07339 | Cathepsin D | 92.36% | 98.95% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 90.94% | 89.00% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 90.67% | 96.09% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 90.48% | 94.00% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 89.60% | 97.09% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 89.44% | 95.56% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 88.45% | 86.33% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 88.43% | 99.15% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 85.92% | 86.92% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 85.92% | 95.89% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 85.48% | 91.49% |
CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 85.31% | 91.71% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 83.63% | 94.45% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 81.46% | 99.23% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 81.43% | 100.00% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 80.15% | 96.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Vernicia fordii |
PubChem | 162897153 |
LOTUS | LTS0102904 |
wikiData | Q104953359 |