21,25-Dimethoxy-15,30-dimethyl-8,23-dioxa-15,30-diazaheptacyclo[22.6.2.29,12.13,7.114,18.027,31.022,33]hexatriaconta-3(36),4,6,9(35),10,12(34),18,20,22(33),24,26,31-dodecaene-6,20-diol
Internal ID | e70d09e9-d1af-4876-b949-018432b22bd0 |
Taxonomy | Lignans, neolignans and related compounds |
IUPAC Name | 21,25-dimethoxy-15,30-dimethyl-8,23-dioxa-15,30-diazaheptacyclo[22.6.2.29,12.13,7.114,18.027,31.022,33]hexatriaconta-3(36),4,6,9(35),10,12(34),18,20,22(33),24,26,31-dodecaene-6,20-diol |
SMILES (Canonical) | CN1CCC2=CC(=C(C3=C2C1CC4=CC=C(C=C4)OC5=C(C=CC(=C5)CC6C7=CC(=C(C=C7CCN6C)OC)O3)O)OC)O |
SMILES (Isomeric) | CN1CCC2=CC(=C(C3=C2C1CC4=CC=C(C=C4)OC5=C(C=CC(=C5)CC6C7=CC(=C(C=C7CCN6C)OC)O3)O)OC)O |
InChI | InChI=1S/C36H38N2O6/c1-37-13-11-23-19-32(41-3)33-20-26(23)27(37)16-22-7-10-29(39)31(17-22)43-25-8-5-21(6-9-25)15-28-34-24(12-14-38(28)2)18-30(40)35(42-4)36(34)44-33/h5-10,17-20,27-28,39-40H,11-16H2,1-4H3 |
InChI Key | GGGLDIBSBGBODX-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C36H38N2O6 |
Molecular Weight | 594.70 g/mol |
Exact Mass | 594.27298694 g/mol |
Topological Polar Surface Area (TPSA) | 83.90 Ų |
XlogP | 6.00 |
There are no found synonyms. |
![2D Structure of 21,25-Dimethoxy-15,30-dimethyl-8,23-dioxa-15,30-diazaheptacyclo[22.6.2.29,12.13,7.114,18.027,31.022,33]hexatriaconta-3(36),4,6,9(35),10,12(34),18,20,22(33),24,26,31-dodecaene-6,20-diol 2D Structure of 21,25-Dimethoxy-15,30-dimethyl-8,23-dioxa-15,30-diazaheptacyclo[22.6.2.29,12.13,7.114,18.027,31.022,33]hexatriaconta-3(36),4,6,9(35),10,12(34),18,20,22(33),24,26,31-dodecaene-6,20-diol](https://plantaedb.com/storage/docs/compounds/2023/11/a5310080-8392-11ee-8eea-7b04a94e2076.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 99.48% | 96.09% |
CHEMBL217 | P14416 | Dopamine D2 receptor | 95.89% | 95.62% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 95.87% | 91.11% |
CHEMBL2056 | P21728 | Dopamine D1 receptor | 94.96% | 91.00% |
CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 91.00% | 93.40% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 89.91% | 94.45% |
CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 89.57% | 89.62% |
CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 89.18% | 93.99% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 88.49% | 95.56% |
CHEMBL2069156 | Q14145 | Kelch-like ECH-associated protein 1 | 88.21% | 82.38% |
CHEMBL2581 | P07339 | Cathepsin D | 88.02% | 98.95% |
CHEMBL2535 | P11166 | Glucose transporter | 87.03% | 98.75% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 86.53% | 85.14% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 86.06% | 95.89% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 85.92% | 89.00% |
CHEMBL4208 | P20618 | Proteasome component C5 | 85.06% | 90.00% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 84.71% | 92.94% |
CHEMBL2085 | P14174 | Macrophage migration inhibitory factor | 83.10% | 80.78% |
CHEMBL5469 | Q14289 | Protein tyrosine kinase 2 beta | 82.86% | 91.03% |
CHEMBL261 | P00915 | Carbonic anhydrase I | 82.83% | 96.76% |
CHEMBL2335 | P42785 | Lysosomal Pro-X carboxypeptidase | 82.81% | 100.00% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 82.28% | 90.71% |
CHEMBL5311 | P37023 | Serine/threonine-protein kinase receptor R3 | 82.26% | 82.67% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 81.63% | 94.00% |
CHEMBL2413 | P32246 | C-C chemokine receptor type 1 | 81.53% | 89.50% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 81.31% | 99.17% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Berberis aquifolium |
PubChem | 10031406 |
LOTUS | LTS0239911 |
wikiData | Q105008034 |