[(3R,8S,9S,10R,13S,14S,17S)-17-[(1R)-1-[(2R,4R,5S)-5,6-dihydroxy-4-methoxy-4,5-dimethyloxan-2-yl]ethyl]-17-hydroxy-10,13-dimethyl-1-oxo-3,4,7,8,9,11,12,14,15,16-decahydro-2H-cyclopenta[a]phenanthren-3-yl] hydrogen sulfate
Internal ID | d31dbb30-cadd-4bd4-af00-780ad8fdb463 |
Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Sulfated steroids |
IUPAC Name | [(3R,8S,9S,10R,13S,14S,17S)-17-[(1R)-1-[(2R,4R,5S)-5,6-dihydroxy-4-methoxy-4,5-dimethyloxan-2-yl]ethyl]-17-hydroxy-10,13-dimethyl-1-oxo-3,4,7,8,9,11,12,14,15,16-decahydro-2H-cyclopenta[a]phenanthren-3-yl] hydrogen sulfate |
SMILES (Canonical) | CC(C1CC(C(C(O1)O)(C)O)(C)OC)C2(CCC3C2(CCC4C3CC=C5C4(C(=O)CC(C5)OS(=O)(=O)O)C)C)O |
SMILES (Isomeric) | C[C@H]([C@H]1C[C@@]([C@](C(O1)O)(C)O)(C)OC)[C@]2(CC[C@@H]3[C@@]2(CC[C@H]4[C@H]3CC=C5[C@@]4(C(=O)C[C@@H](C5)OS(=O)(=O)O)C)C)O |
InChI | InChI=1S/C29H46O10S/c1-16(22-15-26(3,37-6)28(5,32)24(31)38-22)29(33)12-10-20-19-8-7-17-13-18(39-40(34,35)36)14-23(30)27(17,4)21(19)9-11-25(20,29)2/h7,16,18-22,24,31-33H,8-15H2,1-6H3,(H,34,35,36)/t16-,18-,19+,20+,21+,22-,24?,25+,26-,27+,28-,29+/m1/s1 |
InChI Key | FUZRIJMEWYDBHU-CPNUZBHASA-N |
Popularity | 0 references in papers |
Molecular Formula | C29H46O10S |
Molecular Weight | 586.70 g/mol |
Exact Mass | 586.28116883 g/mol |
Topological Polar Surface Area (TPSA) | 168.00 Ų |
XlogP | 1.50 |
There are no found synonyms. |
![2D Structure of [(3R,8S,9S,10R,13S,14S,17S)-17-[(1R)-1-[(2R,4R,5S)-5,6-dihydroxy-4-methoxy-4,5-dimethyloxan-2-yl]ethyl]-17-hydroxy-10,13-dimethyl-1-oxo-3,4,7,8,9,11,12,14,15,16-decahydro-2H-cyclopenta[a]phenanthren-3-yl] hydrogen sulfate 2D Structure of [(3R,8S,9S,10R,13S,14S,17S)-17-[(1R)-1-[(2R,4R,5S)-5,6-dihydroxy-4-methoxy-4,5-dimethyloxan-2-yl]ethyl]-17-hydroxy-10,13-dimethyl-1-oxo-3,4,7,8,9,11,12,14,15,16-decahydro-2H-cyclopenta[a]phenanthren-3-yl] hydrogen sulfate](https://plantaedb.com/storage/docs/compounds/2023/11/a522ee80-8638-11ee-b150-f1bec94be36f.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 98.14% | 94.75% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 96.05% | 94.45% |
CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 94.88% | 96.38% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 94.87% | 96.09% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 92.56% | 95.56% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 91.99% | 94.00% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 91.81% | 95.93% |
CHEMBL2179 | P04062 | Beta-glucocerebrosidase | 91.18% | 85.31% |
CHEMBL2581 | P07339 | Cathepsin D | 91.09% | 98.95% |
CHEMBL284 | P27487 | Dipeptidyl peptidase IV | 90.94% | 95.69% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 90.43% | 97.25% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 89.63% | 100.00% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 88.73% | 97.09% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 88.37% | 99.23% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 87.99% | 97.14% |
CHEMBL3524 | P56524 | Histone deacetylase 4 | 87.71% | 92.97% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 87.50% | 92.94% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 87.33% | 90.71% |
CHEMBL2959 | Q08881 | Tyrosine-protein kinase ITK/TSK | 86.54% | 95.00% |
CHEMBL255 | P29275 | Adenosine A2b receptor | 85.63% | 98.59% |
CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 85.22% | 93.99% |
CHEMBL4051 | P13569 | Cystic fibrosis transmembrane conductance regulator | 84.87% | 95.71% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 84.41% | 86.33% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 84.15% | 95.89% |
CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 83.98% | 93.03% |
CHEMBL2335 | P42785 | Lysosomal Pro-X carboxypeptidase | 83.96% | 100.00% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 83.62% | 91.11% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 83.41% | 91.19% |
CHEMBL1907605 | P24864 | Cyclin-dependent kinase 2/cyclin E1 | 82.52% | 92.88% |
CHEMBL4940 | P07195 | L-lactate dehydrogenase B chain | 81.99% | 95.53% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 81.40% | 89.00% |
CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 80.69% | 90.08% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Solanum capsicoides |
PubChem | 10698576 |
LOTUS | LTS0077936 |
wikiData | Q105002218 |