[(2R,3R,4S,6R)-3-[(2S,3R,4S,5R,6S)-3,4-dihydroxy-6-methyl-5-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-2-yl]oxy-6-[[(3S,5S,8R,9S,10S,13R,14S,17R)-10-formyl-5,14-dihydroxy-13-methyl-17-(5-oxo-2H-furan-3-yl)-2,3,4,6,7,8,9,11,12,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy]-2-methyloxan-4-yl] acetate
Internal ID | 1c947fb6-c6b5-4683-a52e-a2189aa1f012 |
Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Steroid lactones > Cardenolides and derivatives > Cardenolide glycosides and derivatives |
IUPAC Name | [(2R,3R,4S,6R)-3-[(2S,3R,4S,5R,6S)-3,4-dihydroxy-6-methyl-5-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-2-yl]oxy-6-[[(3S,5S,8R,9S,10S,13R,14S,17R)-10-formyl-5,14-dihydroxy-13-methyl-17-(5-oxo-2H-furan-3-yl)-2,3,4,6,7,8,9,11,12,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy]-2-methyloxan-4-yl] acetate |
SMILES (Canonical) | CC1C(C(CC(O1)OC2CCC3(C4CCC5(C(CCC5(C4CCC3(C2)O)O)C6=CC(=O)OC6)C)C=O)OC(=O)C)OC7C(C(C(C(O7)C)OC8C(C(C(C(O8)CO)O)O)O)O)O |
SMILES (Isomeric) | C[C@@H]1[C@H]([C@H](C[C@@H](O1)O[C@H]2CC[C@@]3([C@H]4CC[C@@]5([C@H](CC[C@@]5([C@@H]4CC[C@@]3(C2)O)O)C6=CC(=O)OC6)C)C=O)OC(=O)C)O[C@H]7[C@@H]([C@@H]([C@H]([C@@H](O7)C)O[C@H]8[C@@H]([C@H]([C@@H]([C@H](O8)CO)O)O)O)O)O |
InChI | InChI=1S/C43H64O19/c1-19-36(61-38-35(52)33(50)37(20(2)57-38)62-39-34(51)32(49)31(48)28(16-44)60-39)27(58-21(3)46)14-30(56-19)59-23-5-10-41(18-45)25-6-9-40(4)24(22-13-29(47)55-17-22)8-12-43(40,54)26(25)7-11-42(41,53)15-23/h13,18-20,23-28,30-39,44,48-54H,5-12,14-17H2,1-4H3/t19-,20+,23+,24-,25+,26-,27+,28-,30+,31-,32+,33+,34-,35-,36-,37+,38+,39+,40-,41+,42+,43+/m1/s1 |
InChI Key | BXXHNQDTEFIKSJ-NCUGGUGSSA-N |
Popularity | 0 references in papers |
Molecular Formula | C43H64O19 |
Molecular Weight | 885.00 g/mol |
Exact Mass | 884.40417981 g/mol |
Topological Polar Surface Area (TPSA) | 287.00 Ų |
XlogP | -1.80 |
There are no found synonyms. |
![2D Structure of [(2R,3R,4S,6R)-3-[(2S,3R,4S,5R,6S)-3,4-dihydroxy-6-methyl-5-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-2-yl]oxy-6-[[(3S,5S,8R,9S,10S,13R,14S,17R)-10-formyl-5,14-dihydroxy-13-methyl-17-(5-oxo-2H-furan-3-yl)-2,3,4,6,7,8,9,11,12,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy]-2-methyloxan-4-yl] acetate 2D Structure of [(2R,3R,4S,6R)-3-[(2S,3R,4S,5R,6S)-3,4-dihydroxy-6-methyl-5-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-2-yl]oxy-6-[[(3S,5S,8R,9S,10S,13R,14S,17R)-10-formyl-5,14-dihydroxy-13-methyl-17-(5-oxo-2H-furan-3-yl)-2,3,4,6,7,8,9,11,12,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy]-2-methyloxan-4-yl] acetate](https://plantaedb.com/storage/docs/compounds/2023/11/a520c8c0-8615-11ee-b322-f1bb4b2072f5.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.22% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.49% | 96.09% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 96.96% | 100.00% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 96.41% | 94.45% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 95.54% | 86.33% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 93.75% | 85.14% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 92.93% | 97.09% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 91.64% | 95.93% |
CHEMBL2581 | P07339 | Cathepsin D | 90.99% | 98.95% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 89.89% | 95.56% |
CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 89.58% | 97.36% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 89.00% | 97.25% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 88.99% | 89.00% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 87.46% | 96.00% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 86.38% | 95.89% |
CHEMBL4208 | P20618 | Proteasome component C5 | 84.46% | 90.00% |
CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 83.24% | 94.62% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 82.47% | 95.89% |
CHEMBL1907602 | P06493 | Cyclin-dependent kinase 1/cyclin B1 | 82.43% | 91.24% |
CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 82.37% | 96.77% |
CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 82.13% | 94.33% |
CHEMBL5028 | O14672 | ADAM10 | 80.85% | 97.50% |
CHEMBL3351 | Q13085 | Acetyl-CoA carboxylase 1 | 80.12% | 93.04% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Erysimum cheiranthoides |
PubChem | 100929630 |
LOTUS | LTS0262779 |
wikiData | Q104948915 |