[(2S,3S,4S,5R,6S)-3-[(2S,3R,4S,5R,6S)-3,4-dihydroxy-6-methyl-5-(2-methylpropanoyloxy)oxan-2-yl]oxy-5-hydroxy-2-methyl-6-[[(1R,3S,5S,6S,7S,19S,21R,23S,24S,25R,26R)-24,25,26-trihydroxy-5,23-dimethyl-9-oxo-19-pentyl-2,4,8,20,22-pentaoxatricyclo[19.2.2.13,7]hexacosan-6-yl]oxy]oxan-4-yl] (2S)-2-methylbutanoate
| Internal ID | 4e13b8c7-bf01-4e7b-8092-f43edd30228d |
| Taxonomy | Organic oxygen compounds > Organooxygen compounds > Carbohydrates and carbohydrate conjugates > Oligosaccharides |
| IUPAC Name | [(2S,3S,4S,5R,6S)-3-[(2S,3R,4S,5R,6S)-3,4-dihydroxy-6-methyl-5-(2-methylpropanoyloxy)oxan-2-yl]oxy-5-hydroxy-2-methyl-6-[[(1R,3S,5S,6S,7S,19S,21R,23S,24S,25R,26R)-24,25,26-trihydroxy-5,23-dimethyl-9-oxo-19-pentyl-2,4,8,20,22-pentaoxatricyclo[19.2.2.13,7]hexacosan-6-yl]oxy]oxan-4-yl] (2S)-2-methylbutanoate |
| SMILES (Canonical) | CCCCCC1CCCCCCCCCC(=O)OC2C(C(OC(C2OC3C(C(C(C(O3)C)OC4C(C(C(C(O4)C)OC(=O)C(C)C)O)O)OC(=O)C(C)CC)O)C)OC5C(OC(O1)C(C5O)O)C)O |
| SMILES (Isomeric) | CCCCC[C@H]1CCCCCCCCCC(=O)O[C@H]2[C@H]([C@@H](O[C@H]([C@@H]2O[C@H]3[C@@H]([C@@H]([C@H]([C@@H](O3)C)O[C@H]4[C@@H]([C@@H]([C@H]([C@@H](O4)C)OC(=O)C(C)C)O)O)OC(=O)[C@@H](C)CC)O)C)O[C@H]5[C@@H](O[C@@H](O1)[C@@H]([C@@H]5O)O)C)O |
| InChI | InChI=1S/C49H84O20/c1-10-12-18-21-30-22-19-16-14-13-15-17-20-23-31(50)64-42-36(55)48(67-39-27(7)59-46(63-30)34(53)33(39)52)61-28(8)40(42)69-49-37(56)43(66-45(58)25(5)11-2)41(29(9)62-49)68-47-35(54)32(51)38(26(6)60-47)65-44(57)24(3)4/h24-30,32-43,46-49,51-56H,10-23H2,1-9H3/t25-,26-,27-,28-,29-,30-,32-,33-,34+,35+,36+,37+,38-,39-,40-,41-,42-,43-,46-,47-,48-,49-/m0/s1 |
| InChI Key | KGCDKHUXQPWIMR-SEJMAIFUSA-N |
| Popularity | 2 references in papers |
| Molecular Formula | C49H84O20 |
| Molecular Weight | 993.20 g/mol |
| Exact Mass | 992.55559506 g/mol |
| Topological Polar Surface Area (TPSA) | 274.00 Ų |
| XlogP | 5.20 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 99.21% | 98.95% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 97.64% | 97.25% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.12% | 91.11% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.00% | 96.09% |
| CHEMBL1914 | P06276 | Butyrylcholinesterase | 94.95% | 95.00% |
| CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 94.18% | 92.62% |
| CHEMBL4462 | Q8IXJ6 | NAD-dependent deacetylase sirtuin 2 | 93.84% | 90.24% |
| CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 92.80% | 96.47% |
| CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 92.35% | 100.00% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 89.41% | 89.00% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 89.09% | 93.56% |
| CHEMBL5255 | O00206 | Toll-like receptor 4 | 88.54% | 92.50% |
| CHEMBL3475 | P05121 | Plasminogen activator inhibitor-1 | 88.16% | 83.00% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 88.06% | 90.71% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 87.98% | 95.89% |
| CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 86.96% | 96.77% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 86.90% | 99.17% |
| CHEMBL1968 | P07099 | Epoxide hydrolase 1 | 86.61% | 98.57% |
| CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 86.08% | 96.38% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 85.83% | 97.09% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 85.30% | 91.19% |
| CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 85.26% | 94.33% |
| CHEMBL3145 | P42338 | PI3-kinase p110-beta subunit | 84.40% | 98.75% |
| CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 83.24% | 95.50% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 82.25% | 86.33% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 82.25% | 95.56% |
| CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 82.14% | 97.36% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Decalobanthus mammosus |
| PubChem | 10533985 |
| LOTUS | LTS0052663 |
| wikiData | Q105140679 |