2-[4-Hydroxy-2-(hydroxymethyl)-6-[[7-hydroxy-7,9,13-trimethyl-6-[3-methyl-4-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxybutylidene]-5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icosan-16-yl]oxy]-5-(3,4,5-trihydroxy-6-methyloxan-2-yl)oxyoxan-3-yl]oxy-6-methyloxane-3,4,5-triol
Internal ID | 638c8898-356f-4a79-a4a7-df8eadfe4c44 |
Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Steroidal glycosides |
IUPAC Name | 2-[4-hydroxy-2-(hydroxymethyl)-6-[[7-hydroxy-7,9,13-trimethyl-6-[3-methyl-4-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxybutylidene]-5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icosan-16-yl]oxy]-5-(3,4,5-trihydroxy-6-methyloxan-2-yl)oxyoxan-3-yl]oxy-6-methyloxane-3,4,5-triol |
SMILES (Canonical) | CC1C(C(C(C(O1)OC2C(OC(C(C2O)OC3C(C(C(C(O3)C)O)O)O)OC4CCC5(C(C4)CCC6C5CCC7(C6CC8C7C(C(=CCC(C)COC9C(C(C(C(O9)CO)O)O)O)O8)(C)O)C)C)CO)O)O)O |
SMILES (Isomeric) | CC1C(C(C(C(O1)OC2C(OC(C(C2O)OC3C(C(C(C(O3)C)O)O)O)OC4CCC5(C(C4)CCC6C5CCC7(C6CC8C7C(C(=CCC(C)COC9C(C(C(C(O9)CO)O)O)O)O8)(C)O)C)C)CO)O)O)O |
InChI | InChI=1S/C51H84O22/c1-20(19-65-45-38(60)37(59)34(56)29(17-52)70-45)7-10-31-51(6,64)44-28(69-31)16-27-25-9-8-23-15-24(11-13-49(23,4)26(25)12-14-50(27,44)5)68-48-43(73-47-40(62)36(58)33(55)22(3)67-47)41(63)42(30(18-53)71-48)72-46-39(61)35(57)32(54)21(2)66-46/h10,20-30,32-48,52-64H,7-9,11-19H2,1-6H3 |
InChI Key | LBLFKZKGYZPTGD-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C51H84O22 |
Molecular Weight | 1049.20 g/mol |
Exact Mass | 1048.54542430 g/mol |
Topological Polar Surface Area (TPSA) | 346.00 Ų |
XlogP | -1.00 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.40% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.52% | 96.09% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 94.07% | 97.25% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 91.94% | 97.09% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 91.46% | 94.45% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 90.11% | 100.00% |
CHEMBL2955 | O95136 | Sphingosine 1-phosphate receptor Edg-5 | 87.92% | 92.86% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 87.37% | 89.00% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 87.14% | 95.93% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 86.33% | 95.89% |
CHEMBL3892 | Q99500 | Sphingosine 1-phosphate receptor Edg-3 | 85.00% | 97.29% |
CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 84.78% | 91.71% |
CHEMBL4681 | P42330 | Aldo-keto-reductase family 1 member C3 | 84.55% | 89.05% |
CHEMBL4581 | P52732 | Kinesin-like protein 1 | 84.37% | 93.18% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 84.07% | 100.00% |
CHEMBL237 | P41145 | Kappa opioid receptor | 83.92% | 98.10% |
CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 83.55% | 96.21% |
CHEMBL2996 | Q05655 | Protein kinase C delta | 83.32% | 97.79% |
CHEMBL6136 | O60341 | Lysine-specific histone demethylase 1 | 82.61% | 95.58% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 81.95% | 96.00% |
CHEMBL2094135 | Q96BI3 | Gamma-secretase | 81.64% | 98.05% |
CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 80.60% | 93.56% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 80.52% | 95.89% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 80.08% | 92.94% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Allium tuberosum |
PubChem | 73109811 |
LOTUS | LTS0075067 |
wikiData | Q105149428 |