(1R,2S,3R,3'R,5R,6S,7S,8S,9S,12R)-3',12-dihydroxy-3'-[(1S)-1-hydroxyethyl]-8-methoxy-7-methyl-12-propan-2-ylspiro[4,10-dioxatetracyclo[7.2.1.02,7.03,5]dodecane-6,5'-oxolane]-2',11-dione
| Internal ID | 3d4b3ba8-6796-4d92-b605-678f634ce95b |
| Taxonomy | Organoheterocyclic compounds > Lactones > Gamma butyrolactones |
| IUPAC Name | (1R,2S,3R,3'R,5R,6S,7S,8S,9S,12R)-3',12-dihydroxy-3'-[(1S)-1-hydroxyethyl]-8-methoxy-7-methyl-12-propan-2-ylspiro[4,10-dioxatetracyclo[7.2.1.02,7.03,5]dodecane-6,5'-oxolane]-2',11-dione |
| SMILES (Canonical) | CC(C)C1(C2C3C4C(O4)C5(C3(C(C1OC2=O)OC)C)CC(C(=O)O5)(C(C)O)O)O |
| SMILES (Isomeric) | C[C@@H]([C@@]1(C[C@]2([C@H]3[C@H](O3)[C@@H]4[C@]2([C@@H]([C@H]5[C@]([C@@H]4C(=O)O5)(C(C)C)O)OC)C)OC1=O)O)O |
| InChI | InChI=1S/C20H28O9/c1-7(2)20(25)10-9-11-12(27-11)19(6-18(24,8(3)21)16(23)29-19)17(9,4)13(26-5)14(20)28-15(10)22/h7-14,21,24-25H,6H2,1-5H3/t8-,9+,10-,11+,12+,13+,14-,17-,18+,19+,20+/m0/s1 |
| InChI Key | ZQSCAIZLHQRUNM-ZMBGDYABSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C20H28O9 |
| Molecular Weight | 412.40 g/mol |
| Exact Mass | 412.17333247 g/mol |
| Topological Polar Surface Area (TPSA) | 135.00 Ų |
| XlogP | 0.00 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 97.84% | 97.25% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.13% | 96.09% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 93.97% | 85.14% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 93.74% | 91.11% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 89.51% | 97.14% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 88.00% | 94.45% |
| CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 87.78% | 96.38% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 87.19% | 99.23% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 87.18% | 95.89% |
| CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 87.18% | 96.47% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 86.74% | 95.56% |
| CHEMBL2581 | P07339 | Cathepsin D | 86.26% | 98.95% |
| CHEMBL1907605 | P24864 | Cyclin-dependent kinase 2/cyclin E1 | 84.53% | 92.88% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 82.36% | 97.09% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 82.31% | 89.00% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 81.84% | 94.75% |
| CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 81.45% | 96.77% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 80.46% | 94.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Picrodendron baccatum |
| PubChem | 163052501 |
| LOTUS | LTS0211450 |
| wikiData | Q105381704 |