[(9R,10R,11S)-11-hydroxy-4,5,19-trimethoxy-9,10-dimethyl-15,17-dioxatetracyclo[10.7.0.02,7.014,18]nonadeca-1(19),2,4,6,12,14(18)-hexaen-3-yl] benzoate
Internal ID | fe9f5baa-6464-4f14-82b9-c4e4daf96811 |
Taxonomy | Phenylpropanoids and polyketides > Tannins > Hydrolyzable tannins |
IUPAC Name | [(9R,10R,11S)-11-hydroxy-4,5,19-trimethoxy-9,10-dimethyl-15,17-dioxatetracyclo[10.7.0.02,7.014,18]nonadeca-1(19),2,4,6,12,14(18)-hexaen-3-yl] benzoate |
SMILES (Canonical) | CC1CC2=CC(=C(C(=C2C3=C(C4=C(C=C3C(C1C)O)OCO4)OC)OC(=O)C5=CC=CC=C5)OC)OC |
SMILES (Isomeric) | C[C@@H]1CC2=CC(=C(C(=C2C3=C(C4=C(C=C3[C@H]([C@@H]1C)O)OCO4)OC)OC(=O)C5=CC=CC=C5)OC)OC |
InChI | InChI=1S/C29H30O8/c1-15-11-18-12-20(32-3)25(33-4)28(37-29(31)17-9-7-6-8-10-17)22(18)23-19(24(30)16(15)2)13-21-26(27(23)34-5)36-14-35-21/h6-10,12-13,15-16,24,30H,11,14H2,1-5H3/t15-,16-,24+/m1/s1 |
InChI Key | BRYKANSBPAKIAC-JOWJHRDDSA-N |
Popularity | 0 references in papers |
Molecular Formula | C29H30O8 |
Molecular Weight | 506.50 g/mol |
Exact Mass | 506.19406791 g/mol |
Topological Polar Surface Area (TPSA) | 92.70 Ų |
XlogP | 5.50 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 97.08% | 86.33% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 94.47% | 96.09% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 92.84% | 95.56% |
CHEMBL261 | P00915 | Carbonic anhydrase I | 91.73% | 96.76% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 91.19% | 91.11% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 90.76% | 99.17% |
CHEMBL2535 | P11166 | Glucose transporter | 90.62% | 98.75% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 87.73% | 92.62% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 86.45% | 89.00% |
CHEMBL2581 | P07339 | Cathepsin D | 84.42% | 98.95% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 84.04% | 95.89% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 83.76% | 99.23% |
CHEMBL5028 | O14672 | ADAM10 | 83.39% | 97.50% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 81.45% | 97.14% |
CHEMBL4306 | P22460 | Voltage-gated potassium channel subunit Kv1.5 | 81.06% | 94.03% |
CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 80.21% | 93.99% |
CHEMBL5311 | P37023 | Serine/threonine-protein kinase receptor R3 | 80.10% | 82.67% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Kadsura coccinea |
PubChem | 163069847 |
LOTUS | LTS0066727 |
wikiData | Q104945094 |