Rel-(5R,6R,7S,8S)-1,2,3,13-tetramethoxy-6,7-dimethyl-5,6,7,8-tetrahydro-5,8-epoxybenzo[3',4']cycloocta[1',2':4,5]benzo[1,2-d][1,3]dioxole
Internal ID | 25497633-3fe6-4375-be69-d01949a661a0 |
Taxonomy | Phenylpropanoids and polyketides > Tannins > Hydrolyzable tannins |
IUPAC Name | (1S,17R,18R,19S)-9,12,13,14-tetramethoxy-18,19-dimethyl-5,7,20-trioxapentacyclo[15.2.1.02,10.04,8.011,16]icosa-2,4(8),9,11,13,15-hexaene |
SMILES (Canonical) | CC1C(C2C3=CC(=C(C(=C3C4=C(C5=C(C=C4C1O2)OCO5)OC)OC)OC)OC)C |
SMILES (Isomeric) | C[C@H]1[C@H]([C@@H]2C3=CC(=C(C(=C3C4=C(C5=C(C=C4[C@H]1O2)OCO5)OC)OC)OC)OC)C |
InChI | InChI=1S/C23H26O7/c1-10-11(2)19-13-8-15-21(29-9-28-15)23(27-6)17(13)16-12(18(10)30-19)7-14(24-3)20(25-4)22(16)26-5/h7-8,10-11,18-19H,9H2,1-6H3/t10-,11+,18-,19+/m1/s1 |
InChI Key | RNIZTMIJCBCDBR-GMDPXXIDSA-N |
Popularity | 0 references in papers |
Molecular Formula | C23H26O7 |
Molecular Weight | 414.40 g/mol |
Exact Mass | 414.16785316 g/mol |
Topological Polar Surface Area (TPSA) | 64.60 Ų |
XlogP | 3.90 |
115181-68-5 |
65144-27-6 |
Rel-(5R,6R,7S,8S)-1,2,3,13-tetramethoxy-6,7-dimethyl-5,6,7,8-tetrahydro-5,8-epoxybenzo[3',4']cycloocta[1',2':4,5]benzo[1,2-d][1,3]dioxole |
DTXSID401028067 |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.82% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 94.38% | 96.09% |
CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 92.82% | 96.77% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 91.81% | 86.33% |
CHEMBL4247 | Q9UM73 | ALK tyrosine kinase receptor | 90.03% | 96.86% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 89.11% | 92.62% |
CHEMBL5311 | P37023 | Serine/threonine-protein kinase receptor R3 | 88.47% | 82.67% |
CHEMBL4225 | P49760 | Dual specificity protein kinase CLK2 | 88.43% | 80.96% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 87.09% | 95.56% |
CHEMBL4481 | P35228 | Nitric oxide synthase, inducible | 86.17% | 94.80% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 85.84% | 97.14% |
CHEMBL4306 | P22460 | Voltage-gated potassium channel subunit Kv1.5 | 85.44% | 94.03% |
CHEMBL4208 | P20618 | Proteasome component C5 | 82.18% | 90.00% |
CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 81.98% | 89.62% |
CHEMBL2535 | P11166 | Glucose transporter | 81.23% | 98.75% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 80.92% | 97.09% |
CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 80.88% | 93.99% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 80.20% | 94.45% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Kadsura coccinea |
PubChem | 145709207 |
LOTUS | LTS0127529 |
wikiData | Q105241396 |