[(9S)-4,5-dihydroxy-2-methyl-10-oxo-9H-anthracen-9-yl] octacosanoate
Internal ID | a93dc16f-f2d9-4f4c-8f66-a58b0b9d5d0b |
Taxonomy | Benzenoids > Anthracenes |
IUPAC Name | [(9S)-4,5-dihydroxy-2-methyl-10-oxo-9H-anthracen-9-yl] octacosanoate |
SMILES (Canonical) | CCCCCCCCCCCCCCCCCCCCCCCCCCCC(=O)OC1C2=C(C(=CC=C2)O)C(=O)C3=C1C=C(C=C3O)C |
SMILES (Isomeric) | CCCCCCCCCCCCCCCCCCCCCCCCCCCC(=O)O[C@H]1C2=C(C(=CC=C2)O)C(=O)C3=C1C=C(C=C3O)C |
InChI | InChI=1S/C43H66O5/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23-24-25-26-27-31-39(46)48-43-35-29-28-30-37(44)40(35)42(47)41-36(43)32-34(2)33-38(41)45/h28-30,32-33,43-45H,3-27,31H2,1-2H3/t43-/m0/s1 |
InChI Key | RNTGMQSIVNIXSZ-QLKFWGTOSA-N |
Popularity | 0 references in papers |
Molecular Formula | C43H66O5 |
Molecular Weight | 663.00 g/mol |
Exact Mass | 662.49102520 g/mol |
Topological Polar Surface Area (TPSA) | 83.80 Ų |
XlogP | 16.80 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL2581 | P07339 | Cathepsin D | 99.08% | 98.95% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.81% | 91.11% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 95.34% | 95.56% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 94.79% | 99.17% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 94.60% | 96.09% |
CHEMBL4769 | O95749 | Geranylgeranyl pyrophosphate synthetase | 93.19% | 92.08% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 91.70% | 99.23% |
CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 90.87% | 96.95% |
CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 90.34% | 93.03% |
CHEMBL3401 | O75469 | Pregnane X receptor | 90.29% | 94.73% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 90.08% | 86.33% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 88.55% | 89.00% |
CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 87.81% | 93.56% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 86.76% | 91.19% |
CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 84.69% | 97.21% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 83.38% | 92.50% |
CHEMBL3180 | O00748 | Carboxylesterase 2 | 82.71% | 90.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Rheum australe |
PubChem | 163041247 |
LOTUS | LTS0204384 |
wikiData | Q105241822 |