9H-Xanthen-9-one, 7-hydroxy-1-methoxy-
| Internal ID | ca9702fc-f167-4c35-a5ad-ada6eb4ce4f7 |
| Taxonomy | Organoheterocyclic compounds > Benzopyrans > 1-benzopyrans > Xanthones |
| IUPAC Name | 7-hydroxy-1-methoxyxanthen-9-one |
| SMILES (Canonical) | COC1=CC=CC2=C1C(=O)C3=C(O2)C=CC(=C3)O |
| SMILES (Isomeric) | COC1=CC=CC2=C1C(=O)C3=C(O2)C=CC(=C3)O |
| InChI | InChI=1S/C14H10O4/c1-17-11-3-2-4-12-13(11)14(16)9-7-8(15)5-6-10(9)18-12/h2-7,15H,1H3 |
| InChI Key | FWBCCNVJDMEVSM-UHFFFAOYSA-N |
| Popularity | 3 references in papers |
| Molecular Formula | C14H10O4 |
| Molecular Weight | 242.23 g/mol |
| Exact Mass | 242.05790880 g/mol |
| Topological Polar Surface Area (TPSA) | 55.80 Ų |
| XlogP | 2.60 |
| 9H-Xanthen-9-one, 7-hydroxy-1-methoxy- |
| 244121-75-3 |
| DTXSID40440800 |
| BDBM50485133 |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.63% | 91.11% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 96.02% | 95.56% |
| CHEMBL2535 | P11166 | Glucose transporter | 95.44% | 98.75% |
| CHEMBL2581 | P07339 | Cathepsin D | 94.68% | 98.95% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 93.46% | 94.00% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 91.93% | 99.23% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 91.77% | 86.33% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 91.29% | 89.00% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 88.31% | 94.45% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 87.31% | 93.99% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 85.44% | 85.14% |
| CHEMBL1255126 | O15151 | Protein Mdm4 | 84.51% | 90.20% |
| CHEMBL4306 | P22460 | Voltage-gated potassium channel subunit Kv1.5 | 83.70% | 94.03% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 82.27% | 94.73% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 80.88% | 99.17% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Polygala caudata |
| PubChem | 10490332 |
| LOTUS | LTS0108371 |
| wikiData | Q82257215 |