9H-Xanthen-9-one, 3-hydroxy-2,4-dimethoxy-
Internal ID | aea948dd-10a9-47f5-88c4-15df7dad6f41 |
Taxonomy | Organoheterocyclic compounds > Benzopyrans > 1-benzopyrans > Xanthones |
IUPAC Name | 3-hydroxy-2,4-dimethoxyxanthen-9-one |
SMILES (Canonical) | COC1=C(C(=C2C(=C1)C(=O)C3=CC=CC=C3O2)OC)O |
SMILES (Isomeric) | COC1=C(C(=C2C(=C1)C(=O)C3=CC=CC=C3O2)OC)O |
InChI | InChI=1S/C15H12O5/c1-18-11-7-9-12(16)8-5-3-4-6-10(8)20-14(9)15(19-2)13(11)17/h3-7,17H,1-2H3 |
InChI Key | DQAQTPIWHUEPAU-UHFFFAOYSA-N |
Popularity | 4 references in papers |
Molecular Formula | C15H12O5 |
Molecular Weight | 272.25 g/mol |
Exact Mass | 272.06847348 g/mol |
Topological Polar Surface Area (TPSA) | 65.00 Ų |
XlogP | 2.50 |
1225-63-4 |
3-hydroxy-2,4-dimethoxyxanthone |
DTXSID60480763 |
3-HYDROXY-2,4-DIMETHOXYXANTHEN-9-ONE |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.64% | 91.11% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 96.70% | 95.56% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 93.04% | 89.00% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 92.78% | 94.00% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 92.08% | 85.14% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 90.52% | 99.23% |
CHEMBL2581 | P07339 | Cathepsin D | 90.37% | 98.95% |
CHEMBL2535 | P11166 | Glucose transporter | 90.06% | 98.75% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 89.04% | 86.33% |
CHEMBL2002 | P12268 | Inosine-5'-monophosphate dehydrogenase 2 | 87.41% | 98.21% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 85.75% | 92.62% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 82.06% | 95.50% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 81.49% | 99.17% |
CHEMBL216 | P11229 | Muscarinic acetylcholine receptor M1 | 81.32% | 94.23% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 81.14% | 96.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Calophyllum teysmannii |
Cratoxylum cochinchinense |
Hypericum erectum |
Hypericum reflexum |
Kielmeyera coriacea |
Kielmeyera speciosa |
PubChem | 12214333 |
LOTUS | LTS0111312 |
wikiData | Q82315823 |