(2R,3S)-2-(3,4-dihydroxyphenyl)-6-[(2R,3R,4R)-2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxy-3,4-dihydro-2H-chromen-4-yl]-3,4-dihydro-2H-chromene-3,5,7-triol
Internal ID | d6114010-be9f-4f10-9e42-1d92cb3e7962 |
Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Biflavonoids and polyflavonoids |
IUPAC Name | (2R,3S)-2-(3,4-dihydroxyphenyl)-6-[(2R,3R,4R)-2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxy-3,4-dihydro-2H-chromen-4-yl]-3,4-dihydro-2H-chromene-3,5,7-triol |
SMILES (Canonical) | C1C(C(OC2=C1C(=C(C(=C2)O)C3C(C(OC4=CC(=CC(=C34)O)O)C5=CC(=C(C=C5)O)O)O)O)C6=CC(=C(C=C6)O)O)O |
SMILES (Isomeric) | C1[C@@H]([C@H](OC2=C1C(=C(C(=C2)O)[C@H]3[C@H]([C@H](OC4=CC(=CC(=C34)O)O)C5=CC(=C(C=C5)O)O)O)O)C6=CC(=C(C=C6)O)O)O |
InChI | InChI=1S/C30H26O12/c31-13-7-19(36)24-23(8-13)42-30(12-2-4-16(33)18(35)6-12)28(40)26(24)25-20(37)10-22-14(27(25)39)9-21(38)29(41-22)11-1-3-15(32)17(34)5-11/h1-8,10,21,26,28-40H,9H2/t21-,26-,28+,29+,30+/m0/s1 |
InChI Key | GMISZFQPFDAPGI-GOUWLXHGSA-N |
Popularity | 0 references in papers |
Molecular Formula | C30H26O12 |
Molecular Weight | 578.50 g/mol |
Exact Mass | 578.14242626 g/mol |
Topological Polar Surface Area (TPSA) | 221.00 Ų |
XlogP | 2.40 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.73% | 91.11% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 99.31% | 91.49% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 94.63% | 96.09% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 91.33% | 97.09% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 90.41% | 89.00% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 89.66% | 99.15% |
CHEMBL1929 | P47989 | Xanthine dehydrogenase | 85.70% | 96.12% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 85.49% | 95.56% |
CHEMBL4040 | P28482 | MAP kinase ERK2 | 83.22% | 83.82% |
CHEMBL2535 | P11166 | Glucose transporter | 83.12% | 98.75% |
CHEMBL3194 | P02766 | Transthyretin | 82.79% | 90.71% |
CHEMBL4208 | P20618 | Proteasome component C5 | 82.52% | 90.00% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 82.26% | 95.89% |
CHEMBL3004 | P33527 | Multidrug resistance-associated protein 1 | 81.97% | 96.37% |
CHEMBL3401 | O75469 | Pregnane X receptor | 81.79% | 94.73% |
CHEMBL2581 | P07339 | Cathepsin D | 80.03% | 98.95% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Cinnamomum bejolghota |
Laurus nobilis |
PubChem | 102266638 |
LOTUS | LTS0206542 |
wikiData | Q105011894 |